Overview
Basic information about this protein and its source genome.
- Accession
- VK055_4003
- Gene
- AIK82550.1 ureC
- Status
- annotated
- Amino acids
- 567
- Structure source
- Experimental + ColabFold
Target profile
Computed evidence for target prioritization.
- Human off-target
- No hit
- Human identity (%)
- 0.0
- Gut microbiome off-target
- hit
- Essential (DEG)
- Y
- DEG identity (%)
- 62.61
- DEG E-value
- 0.0
- Localization
- Cytoplasmic
- ColabFold pLDDT
- 98.16
Selected Druggability evidence
PDB experimental structureSelected Druggability is the FPocket score chosen for ranking using the curated structure priority. The 3D viewer may show a different loaded structure, so its visible pockets can differ.
Sequence
Primary amino-acid sequence viewer.
Functional Annotations
Enzyme classification and Gene Ontology terms linked to this protein.
Enzyme Commission (EC)
1Gene Ontology (GO)
7- GO:0016810 Catalysis of the hydrolysis of any carbon-nitrogen bond, C-N, with the exception of peptide bonds.
- GO:0009039 Catalysis of the reaction: urea + 2 H2O + H+ = hydrogencarbonate + 2 NH4+.
- GO:0016787 Catalysis of the hydrolysis of various bonds, e.g. C-O, C-N, C-C, phosphoric anhydride bonds, etc.
- GO:0016151 Binding to a nickel (Ni) cation.
- GO:0006807 OBSOLETE. The chemical reactions and pathways involving organic or inorganic compounds that contain nitrogen.
- GO:0005737 The contents of a cell excluding the plasma membrane and nucleus, but including other subcellular structures.
- GO:0043419 The chemical reactions and pathways resulting in the breakdown of urea, the water soluble compound O=C-(NH2)2.
Sequence Features
Domain/signature hits from InterPro and related databases.
Show feature table
| Start | End | DB | Term | Name |
|---|---|---|---|---|
| 130 | 567 | SUPERFAMILY | SSF51556 | Metallo-dependent hydrolases |
| 130 | 567 | InterPro | IPR032466 | Metal-dependent hydrolase |
| 3 | 567 | PANTHER | PTHR43440 | UREASE |
| 2 | 177 | SUPERFAMILY | SSF51338 | Composite domain of metallo-dependent hydrolases |
| 2 | 177 | InterPro | IPR011059 | Metal-dependent hydrolase, composite domain superfamily |
| 3 | 566 | CDD | cd00375 | Urease_alpha |
| 3 | 566 | InterPro | IPR005848 | Urease, alpha subunit |
| 4 | 480 | Gene3D | G3DSA:2.30.40.10 | Urease, subunit C, domain 1 |
| 4 | 480 | InterPro | IPR011059 | Metal-dependent hydrolase, composite domain superfamily |
| 334 | 350 | PRINTS | PR01752 | Urea amidohydrolase (urease) protein signature |
| 334 | 350 | InterPro | IPR005848 | Urease, alpha subunit |
| 427 | 440 | PRINTS | PR01752 | Urea amidohydrolase (urease) protein signature |
| 427 | 440 | InterPro | IPR005848 | Urease, alpha subunit |
| 401 | 416 | PRINTS | PR01752 | Urea amidohydrolase (urease) protein signature |
| 401 | 416 | InterPro | IPR005848 | Urease, alpha subunit |
| 295 | 312 | PRINTS | PR01752 | Urea amidohydrolase (urease) protein signature |
| 295 | 312 | InterPro | IPR005848 | Urease, alpha subunit |
| 422 | 477 | SUPERFAMILY | SSF51338 | Composite domain of metallo-dependent hydrolases |
| 422 | 477 | InterPro | IPR011059 | Metal-dependent hydrolase, composite domain superfamily |
| 4 | 567 | NCBIfam | TIGR01792 | urease subunit alpha |
| 4 | 567 | InterPro | IPR005848 | Urease, alpha subunit |
| 317 | 333 | ProSitePatterns | PS00145 | Urease active site. |
| 317 | 333 | InterPro | IPR017950 | Urease active site |
| 2 | 567 | Hamap | MF_01953 | Urease subunit alpha [ureC]. |
| 2 | 567 | InterPro | IPR005848 | Urease, alpha subunit |
| 125 | 453 | Pfam | PF01979 | Amidohydrolase family |
| 125 | 453 | InterPro | IPR006680 | Amidohydrolase-related |
| 129 | 567 | Gene3D | G3DSA:3.20.20.140 | - |
| 129 | 567 | ProSiteProfiles | PS51368 | Urease domain profile. |
| 129 | 567 | InterPro | IPR017951 | Urease alpha subunit, C-terminal |
| 3 | 119 | Pfam | PF00449 | Urease alpha-subunit, N-terminal domain |
| 3 | 119 | InterPro | IPR011612 | Urease alpha-subunit, N-terminal domain |
| 127 | 140 | ProSitePatterns | PS01120 | Urease nickel ligands signature. |
| 127 | 140 | InterPro | IPR029754 | Urease nickel binding site |
3D Structure
Selected loaded structure. Experimental PDB entries may cover only a portion of the sequence; predicted models typically cover the full protein.
Loading 3D structure...
Structural evidence
1 + 1Experimental PDB entries and predicted models. Click Switch to display a different structure in the viewer.
Pocket details FPocket · P2Rank — toggle visibility and zoom from here, or open full viewer
Pockets (FPOCKET)
Showing top-ranked FPocket candidates by druggability. Druggability is color-coded: high (0.7 or higher), medium (0.4 to 0.69), low (below 0.4).
| FPOCKET | Sticks | Spheres | Surfaces | Druggability | Labels | Zoom | Positions |
|---|---|---|---|---|---|---|---|
| 45 | 0.924 | ||||||
| 3 | 0.821 | ||||||
| 47 | 0.8 | ||||||
| 7 | 0.672 |
Pockets (P2RANK)
Showing top-ranked P2Rank candidates by probability. Probability is color-coded per P2Rank calibration: high (≥ 0.5), medium (0.2 – 0.49), low (< 0.2).
| P2RANK | Sticks | Spheres | Surfaces | Score | Probability | Labels | Zoom | Positions |
|---|---|---|---|---|---|---|---|---|
| 1 | 21.0 | 0.864 | ||||||
| 2 | 16.33 | 0.776 | ||||||
| 3 | 14.14 | 0.713 | ||||||
| 4 | 13.01 | 0.671 | ||||||
| 5 | 12.75 | 0.661 |
Pockets (FPOCKET)
Showing top-ranked FPocket candidates by druggability. Druggability is color-coded: high (0.7 or higher), medium (0.4 to 0.69), low (below 0.4).
| FPOCKET | Sticks | Spheres | Surfaces | Druggability | Labels | Zoom | Positions |
|---|---|---|---|---|---|---|---|
| 1 | 0.687 | ||||||
| 14 | 0.34 | ||||||
| 10 | 0.335 | ||||||
| 9 | 0.322 |
Pockets (P2RANK)
Showing top-ranked P2Rank candidates by probability. Probability is color-coded per P2Rank calibration: high (≥ 0.5), medium (0.2 – 0.49), low (< 0.2).
| P2RANK | Sticks | Spheres | Surfaces | Score | Probability | Labels | Zoom | Positions |
|---|---|---|---|---|---|---|---|---|
| 1 | 2.54 | 0.072 | ||||||
| 2 | 1.95 | 0.041 | ||||||
| 3 | 1.66 | 0.028 | ||||||
| 4 | 1.33 | 0.015 | ||||||
| 5 | 1.2 | 0.01 |
Ligand evidence
Ligands grouped by evidence source. PDB ligands keep the source crystal visible, and loaded crystals can be opened directly in the structure viewer.
Highest-confidence structural evidence: ligands co-crystallized with this exact protein. If the source PDB is loaded in TPW, use Open crystal to inspect it in the structure viewer.
No PDB structure with a co-crystallized ligand found for this exact protein.
Structural evidence inferred from similar proteins. The source crystal indicates where the ligand was observed; the UniProt column identifies the homologous protein carrying that ligand.
| Ligand | Source crystal | UniProt (homolog) | MW · LogP · TPSA | Lipinski | PAINS | SMILES |
|---|---|---|---|---|---|---|
| 2PA | P41020 | 96.0 Da LogP -1.00 TPSA 89.3 | ✓ Ro5 | ✓ Clean |
NP(=O)(N)O
|
|
| 9XN | P41020 | 113.1 Da LogP -0.85 TPSA 66.5 | ✓ Ro5 | ✓ Clean |
NP(=S)(O)O
|
|
| BO3 | P41020 | 61.8 Da LogP -2.05 TPSA 60.7 | ✓ Ro5 | ✓ Clean |
B(O)(O)O
|
|
| CO2 | P18314 | 44.0 Da LogP -0.58 TPSA 34.1 | ✓ Ro5 | ✓ Clean |
C(=O)=O
|
|
| DBX | P41020 | 190.2 Da LogP 0.34 TPSA 94.8 | ✓ Ro5 | ✓ Clean |
c1cc(c(cc1O)S(=O)(=O)O)O
|
|
| DJM | P69996 | 277.3 Da LogP 2.09 TPSA 67.2 | ✓ Ro5 | ✓ Clean |
Cc1cc(cc(c1)n2ccnc2SCC(=O)NO)C
|
|
| FLC | P41020 | 189.1 Da LogP -5.25 TPSA 140.6 | ✓ Ro5 | ✓ Clean |
C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O
|
|
| HAE | P18314 | 75.1 Da LogP -0.49 TPSA 49.3 | ✓ Ro5 | ✓ Clean |
CC(=O)NO
|
|
| HQE | P41020 | 110.1 Da LogP 1.10 TPSA 40.5 | ✓ Ro5 | ✓ Clean |
c1cc(ccc1O)O
|
Experimental bioactivity from ChEMBL measured directly on this protein. Score = pchembl (−log Ki/IC₅₀; higher = more potent).
No ChEMBL bioactivity data found for this exact protein.
Bioactivity inferred from similar proteins in ChEMBL. Score = pchembl (−log Ki/IC₅₀; higher = more potent).
No ChEMBL hits found through similar proteins.
Proposed virtual-screening candidates from ZINC. Score = Tanimoto similarity to a known binder (0–1; higher = more similar).
| Ligand | Tanimoto | MW · LogP · TPSA | Lipinski | PAINS | SMILES |
|---|---|---|---|---|---|
| ZINC11613699 | 1.000 | 277.3 Da LogP 2.09 TPSA 67.2 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)NO)c1
|
| ZINC7056601 | 0.805 | 275.4 Da LogP 2.33 TPSA 46.9 | ✓ Ro5 | ✓ Clean |
CNC(=O)CSc1nccn1-c1cc(C)cc(C)c1
|
| ZINC2468176 | 0.767 | 365.5 Da LogP 4.84 TPSA 46.9 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(NC(=O)CSc2nccn2-c2cc(C)cc(C)c2)c1
|
| ZINC11252349 | 0.750 | 291.4 Da LogP 2.26 TPSA 56.1 | ✓ Ro5 | ✓ Clean |
CONC(=O)CSc1nccn1-c1cc(C)cc(C)c1
|
| ZINC7283167 | 0.733 | 301.4 Da LogP 2.86 TPSA 46.9 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)NC2CC2)c1
|
| ZINC169299564 | 0.732 | 262.3 Da LogP 2.67 TPSA 55.1 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)O)c1
|
| ZINC13558894 | 0.727 | 262.3 Da LogP 4.43 TPSA 40.5 | ✓ Ro5 | ✓ Clean |
Oc1ccc(-c2ccc(-c3ccc(O)cc3)cc2)cc1
|
| ZINC2723090 | 0.717 | 351.5 Da LogP 4.53 TPSA 46.9 | ✓ Ro5 | ✓ Clean |
Cc1ccc(NC(=O)CSc2nccn2-c2cc(C)cc(C)c2)cc1
|
| ZINC427372 | 0.717 | 329.5 Da LogP 3.64 TPSA 46.9 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)NC2CCCC2)c1
|
| ZINC2468174 | 0.708 | 416.3 Da LogP 4.98 TPSA 46.9 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)Nc2ccc(Br)cc2)c1
|
| ZINC427368 | 0.702 | 337.4 Da LogP 4.22 TPSA 46.9 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)Nc2ccccc2)c1
|
| ZINC427369 | 0.702 | 343.5 Da LogP 4.03 TPSA 46.9 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)NC2CCCCC2)c1
|
| ZINC7056925 | 0.702 | 333.4 Da LogP 1.87 TPSA 73.2 | ✓ Ro5 | ✓ Clean |
COC(=O)CNC(=O)CSc1nccn1-c1cc(C)cc(C)c1
|
| ZINC18335421 | 0.688 | 353.4 Da LogP 3.93 TPSA 67.2 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)Nc2ccc(O)cc2)c1
|
| ZINC2468188 | 0.688 | 342.4 Da LogP 3.52 TPSA 73.0 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)Nc2cc(C)on2)c1
|
| ZINC4249532 | 0.674 | 249.3 Da LogP 1.47 TPSA 67.2 | ✓ Ro5 | ✓ Clean |
O=C(CSc1nccn1-c1ccccc1)NO
|
| ZINC2468165 | 0.673 | 359.5 Da LogP 3.38 TPSA 72.7 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)Nc2nnc(C)s2)c1
|
| ZINC2723088 | 0.673 | 355.4 Da LogP 4.36 TPSA 46.9 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)Nc2ccc(F)cc2)c1
|
| ZINC2723091 | 0.673 | 351.5 Da LogP 4.53 TPSA 46.9 | ✓ Ro5 | ✓ Clean |
Cc1cccc(NC(=O)CSc2nccn2-c2cc(C)cc(C)c2)c1
|
| ZINC2723094 | 0.673 | 365.5 Da LogP 4.84 TPSA 46.9 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)Nc2cc(C)ccc2C)c1
|
| ZINC2723095 | 0.673 | 365.5 Da LogP 4.84 TPSA 46.9 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)Nc2ccc(C)cc2C)c1
|
| ZINC2723100 | 0.673 | 371.9 Da LogP 4.87 TPSA 46.9 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)Nc2ccc(Cl)cc2)c1
|
| ZINC427370 | 0.673 | 344.5 Da LogP 3.68 TPSA 59.8 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)Nc2nccs2)c1
|
| ZINC10271325 | 0.660 | 342.4 Da LogP 3.52 TPSA 73.0 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)Nc2cc(C)no2)c1
|
| ZINC10271326 | 0.660 | 328.4 Da LogP 3.21 TPSA 73.0 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)Nc2ccon2)c1
|
| ZINC12547709 | 0.660 | 369.5 Da LogP 3.57 TPSA 64.7 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)Nc2c(C)nn(C)c2C)c1
|
| ZINC2723103 | 0.660 | 365.5 Da LogP 4.78 TPSA 46.9 | ✓ Ro5 | ✓ Clean |
CCc1ccc(NC(=O)CSc2nccn2-c2cc(C)cc(C)c2)cc1
|
| ZINC456077698 | 0.660 | 361.5 Da LogP 3.25 TPSA 67.2 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)N[C@@H](C)CC(C)(C)O)c1
|
| ZINC456077702 | 0.660 | 361.5 Da LogP 3.25 TPSA 67.2 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)N[C@H](C)CC(C)(C)O)c1
|
| ZINC84086012 | 0.660 | 345.5 Da LogP 2.88 TPSA 56.2 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)NC2CCOCC2)c1
|
| ZINC1700194 | 0.654 | 254.2 Da LogP -0.11 TPSA 129.0 | ✓ Ro5 | ✓ Clean |
O=S(=O)(O)c1ccc(O)c(S(=O)(=O)O)c1
|
| ZINC4249534 | 0.652 | 283.7 Da LogP 2.12 TPSA 67.2 | ✓ Ro5 | ✓ Clean |
O=C(CSc1nccn1-c1cccc(Cl)c1)NO
|
| ZINC11544611 | 0.647 | 352.5 Da LogP 3.29 TPSA 59.8 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)NCc2ccccn2)c1
|
| ZINC2723087 | 0.647 | 367.5 Da LogP 4.23 TPSA 56.1 | ✓ Ro5 | ✓ Clean |
COc1ccc(NC(=O)CSc2nccn2-c2cc(C)cc(C)c2)cc1
|
| ZINC2723089 | 0.647 | 355.4 Da LogP 4.36 TPSA 46.9 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)Nc2ccccc2F)c1
|
| ZINC2723093 | 0.647 | 365.5 Da LogP 4.84 TPSA 46.9 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)Nc2cccc(C)c2C)c1
|
| ZINC2723101 | 0.647 | 371.9 Da LogP 4.87 TPSA 46.9 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)Nc2cccc(Cl)c2)c1
|
| ZINC54659994 | 0.647 | 343.4 Da LogP 2.91 TPSA 85.8 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)Nc2nc(C)no2)c1
|
| ZINC7120438 | 0.647 | 360.5 Da LogP 2.22 TPSA 76.0 | ✓ Ro5 | ✓ Clean |
CCNC(=O)[C@@H](C)NC(=O)CSc1nccn1-c1cc(C)cc(C)c1
|
| ZINC7120440 | 0.647 | 360.5 Da LogP 2.22 TPSA 76.0 | ✓ Ro5 | ✓ Clean |
CCNC(=O)[C@H](C)NC(=O)CSc1nccn1-c1cc(C)cc(C)c1
|
| ZINC98073415 | 0.647 | 353.4 Da LogP 3.93 TPSA 67.2 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)Nc2cccc(O)c2)c1
|
| ZINC11544195 | 0.642 | 408.6 Da LogP 4.00 TPSA 50.2 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)NC[C@@H](c2ccccc2)N(C…
|
| ZINC11544198 | 0.642 | 408.6 Da LogP 4.00 TPSA 50.2 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)NC[C@H](c2ccccc2)N(C)…
|
| ZINC2723023 | 0.640 | 351.5 Da LogP 4.53 TPSA 46.9 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(NC(=O)CSc2nccn2-c2cccc(C)c2)c1
|
| ZINC58947296 | 0.638 | 315.4 Da LogP 3.20 TPSA 38.1 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)N2CCCC2)c1
|
| ZINC2468183 | 0.635 | 373.4 Da LogP 4.50 TPSA 46.9 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)Nc2ccc(F)cc2F)c1
|
| ZINC2723092 | 0.635 | 381.5 Da LogP 4.62 TPSA 56.1 | ✓ Ro5 | ✓ Clean |
CCOc1ccc(NC(=O)CSc2nccn2-c2cc(C)cc(C)c2)cc1
|
| ZINC2723102 | 0.635 | 355.4 Da LogP 4.36 TPSA 46.9 | ✓ Ro5 | ✓ Clean |
Cc1cc(C)cc(-n2ccnc2SCC(=O)Nc2cccc(F)c2)c1
|
| ZINC7120429 | 0.635 | 374.5 Da LogP 2.61 TPSA 76.0 | ✓ Ro5 | ✓ Clean |
CCCNC(=O)[C@@H](C)NC(=O)CSc1nccn1-c1cc(C)cc(C)c1
|
| ZINC7120432 | 0.635 | 374.5 Da LogP 2.61 TPSA 76.0 | ✓ Ro5 | ✓ Clean |
CCCNC(=O)[C@H](C)NC(=O)CSc1nccn1-c1cc(C)cc(C)c1
|
PDB and ChEMBL records on this protein are shown in full. ChEMBL records from similar proteins are capped at the top 100 per protein (by pchembl) and ZINC at the top 50 (Tanimoto ≥ 0.5). ADME columns are descriptor-based screening flags, not experimental toxicity results.