Overview
Basic information about this protein and its source genome.
- Accession
- PA0024
- Gene
- hemF PA0024
- Status
- annotated
- Amino acids
- 305
- Structure source
- AlphaFold
Target profile
Computed evidence for target prioritization.
- Human off-target
- hit
- Human identity (%)
- 60.0
- Human E-value
- 1.34e-11
- Gut microbiome off-target
- hit
- Essential (DEG)
- Y
- Localization
- Cytoplasmic
Selected Druggability evidence
Selected Druggability is the FPocket score chosen for ranking using the curated structure priority. The 3D viewer may show a different loaded structure, so its visible pockets can differ.
Sequence
Primary amino-acid sequence viewer.
Functional Annotations
Enzyme classification and Gene Ontology terms linked to this protein.
Enzyme Commission (EC)
1Gene Ontology (GO)
6- GO:0005737 The contents of a cell excluding the plasma membrane and nucleus, but including other subcellular structures.
- GO:0004109 Catalysis of the reaction: coproporphyrinogen III + 2 H+ + O2 = 2 CO2 + 2 H2O + protoporphyrinogen IX.
- GO:0046872 Binding to a metal ion.
- GO:0042803 Binding to an identical protein to form a homodimer.
- GO:0006782 The chemical reactions and pathways resulting in the formation of protoporphyrinogen IX.
- GO:0006779 The chemical reactions and pathways resulting in the formation of any member of a large group of derivatives or analogs of porphyrin. Porphyrin consists of a ring of four pyrrole nuclei linked each to the next at their alpha positions through a methine group.
Sequence Features
Domain/signature hits from InterPro and related databases.
Show feature table
| Start | End | DB | Term | Name |
|---|---|---|---|---|
| 2 | 276 | Hamap | MF_00333 | Oxygen-dependent coproporphyrinogen-III oxidase [hemF]. |
| 2 | 276 | InterPro | IPR001260 | Coproporphyrinogen III oxidase, aerobic |
| 3 | 301 | SUPERFAMILY | SSF102886 | Coproporphyrinogen III oxidase |
| 3 | 301 | InterPro | IPR036406 | Oxygen-dependent coproporphyrinogen III oxidase superfamily |
| 1 | 301 | FunFam | G3DSA:3.40.1500.10:FF:000001 | Oxygen-dependent coproporphyrinogen-III oxidase |
| 7 | 301 | PANTHER | PTHR10755 | COPROPORPHYRINOGEN III OXIDASE, MITOCHONDRIAL |
| 7 | 301 | InterPro | IPR001260 | Coproporphyrinogen III oxidase, aerobic |
| 1 | 302 | PIRSF | PIRSF000166 | Coproporphyri_ox |
| 1 | 302 | InterPro | IPR001260 | Coproporphyrinogen III oxidase, aerobic |
| 30 | 46 | PRINTS | PR00073 | Coprogen oxidase signature |
| 30 | 46 | InterPro | IPR001260 | Coproporphyrinogen III oxidase, aerobic |
| 89 | 113 | PRINTS | PR00073 | Coprogen oxidase signature |
| 89 | 113 | InterPro | IPR001260 | Coproporphyrinogen III oxidase, aerobic |
| 261 | 287 | PRINTS | PR00073 | Coprogen oxidase signature |
| 261 | 287 | InterPro | IPR001260 | Coproporphyrinogen III oxidase, aerobic |
| 47 | 68 | PRINTS | PR00073 | Coprogen oxidase signature |
| 47 | 68 | InterPro | IPR001260 | Coproporphyrinogen III oxidase, aerobic |
| 161 | 190 | PRINTS | PR00073 | Coprogen oxidase signature |
| 161 | 190 | InterPro | IPR001260 | Coproporphyrinogen III oxidase, aerobic |
| 233 | 260 | PRINTS | PR00073 | Coprogen oxidase signature |
| 233 | 260 | InterPro | IPR001260 | Coproporphyrinogen III oxidase, aerobic |
| 124 | 146 | PRINTS | PR00073 | Coprogen oxidase signature |
| 124 | 146 | InterPro | IPR001260 | Coproporphyrinogen III oxidase, aerobic |
| 8 | 300 | Pfam | PF01218 | Coproporphyrinogen III oxidase |
| 8 | 300 | InterPro | IPR001260 | Coproporphyrinogen III oxidase, aerobic |
| 1 | 304 | Gene3D | G3DSA:3.40.1500.10 | Coproporphyrinogen III oxidase, aerobic |
| 1 | 304 | InterPro | IPR036406 | Oxygen-dependent coproporphyrinogen III oxidase superfamily |
| 165 | 189 | ProSitePatterns | PS01021 | Coproporphyrinogen III oxidase signature. |
| 165 | 189 | InterPro | IPR018375 | Coproporphyrinogen III oxidase, conserved site |
3D Structure
Selected loaded structure. Experimental PDB entries may cover only a portion of the sequence; predicted models typically cover the full protein.
Loading 3D structure...
Structural evidence
0 + 1Experimental PDB entries and predicted models. Click Switch to display a different structure in the viewer.
| Entry | Method | Resolution | Chain | Coverage | Links | Status |
|---|---|---|---|---|---|---|
|
AlphaFold
PA0024
|
AlphaFold | — | — | full sequence | — | Viewing |
Pocket details FPocket · P2Rank — toggle visibility and zoom from here, or open full viewer
Pockets (FPOCKET)
Showing top-ranked FPocket candidates by druggability. Druggability is color-coded: high (0.7 or higher), medium (0.4 to 0.69), low (below 0.4).
| FPOCKET | Sticks | Spheres | Surfaces | Druggability | Labels | Zoom | Positions |
|---|---|---|---|---|---|---|---|
| 1 | 0.658 |
Ligand evidence
Ligands grouped by evidence source. PDB ligands keep the source crystal visible, and loaded crystals can be opened directly in the structure viewer.
Highest-confidence structural evidence: ligands co-crystallized with this exact protein. If the source PDB is loaded in TPW, use Open crystal to inspect it in the structure viewer.
No PDB structure with a co-crystallized ligand found for this exact protein.
Structural evidence inferred from similar proteins. The source crystal indicates where the ligand was observed; the UniProt column identifies the homologous protein carrying that ligand.
Experimental bioactivity from ChEMBL measured directly on this protein. Score = pchembl (−log Ki/IC₅₀; higher = more potent).
No ChEMBL bioactivity data found for this exact protein.
Bioactivity inferred from similar proteins in ChEMBL. Score = pchembl (−log Ki/IC₅₀; higher = more potent).
| Ligand | UniProt (homolog) | pchembl | MW · LogP · TPSA | Lipinski | PAINS | SMILES |
|---|---|---|---|---|---|---|
| CHEMBL2270643 | Q42840 | 8.52 | 357.3 Da LogP 3.91 TPSA 44.1 | ✓ Ro5 | ✓ Clean |
C#CCOc1cc(-n2nc(C(C)(C)C)sc2=O)c(Cl)cc1Cl
|
Proposed virtual-screening candidates from ZINC. Score = Tanimoto similarity to a known binder (0–1; higher = more similar).
| Ligand | Tanimoto | MW · LogP · TPSA | Lipinski | PAINS | SMILES |
|---|---|---|---|---|---|
| ZINC391863 | 0.778 | 200.2 Da LogP 1.74 TPSA 74.6 | ✓ Ro5 | ✓ Clean |
O=C(O)CC1CCC(CC(=O)O)CC1
|
| ZINC138516278 | 0.730 | 337.3 Da LogP 3.74 TPSA 98.0 | ✓ Ro5 | ✓ Clean |
O=C(O)c1cc2cc(NC(=O)c3cc4cc(F)ccc4[nH]3)ccc2[nH…
|
| ZINC1532902 | 0.700 | 206.2 Da LogP -0.86 TPSA 132.1 | ✓ Ro5 | ✓ Clean |
O=C(O)CC[C@@](O)(CC(=O)O)C(=O)O
|
| ZINC2018106 | 0.700 | 206.2 Da LogP -0.86 TPSA 132.1 | ✓ Ro5 | ✓ Clean |
O=C(O)CC[C@](O)(CC(=O)O)C(=O)O
|
| ZINC12869789 | 0.657 | 206.2 Da LogP 2.01 TPSA 36.1 | ✓ Ro5 | ✓ Clean |
CN(C)C(=O)c1cc2cc(F)ccc2[nH]1
|
| ZINC2582702 | 0.656 | 205.2 Da LogP 1.56 TPSA 90.4 | ✓ Ro5 | ✓ Clean |
O=C(O)c1ccc2[nH]c(C(=O)O)cc2c1
|
| ZINC402742 | 0.656 | 240.1 Da LogP 2.63 TPSA 53.1 | ✓ Ro5 | ✓ Clean |
O=C(O)c1cc2cc(Br)ccc2[nH]1
|
| ZINC3593496 | 0.652 | 206.2 Da LogP -1.16 TPSA 121.1 | ✓ Ro5 | ✓ Clean |
COC(=O)C[C@@](O)(CC(=O)O)C(=O)O
|
| ZINC3593497 | 0.652 | 206.2 Da LogP -1.16 TPSA 121.1 | ✓ Ro5 | ✓ Clean |
COC(=O)C[C@](O)(CC(=O)O)C(=O)O
|
| ZINC20028468 | 0.649 | 232.3 Da LogP 2.54 TPSA 36.1 | ✓ Ro5 | ✓ Clean |
O=C(c1cc2cc(F)ccc2[nH]1)N1CCCC1
|
| ZINC5268899 | 0.639 | 272.3 Da LogP 3.70 TPSA 44.9 | ✓ Ro5 | ✓ Clean |
O=C(Nc1ccc(F)cc1)c1cc2cc(F)ccc2[nH]1
|
| ZINC2122566 | 0.636 | 341.2 Da LogP 3.44 TPSA 57.3 | ✓ Ro5 | ✓ Clean |
C#CCOc1cc(-n2nc(C(C)(C)C)oc2=O)c(Cl)cc1Cl
|
| ZINC2432858 | 0.636 | 287.1 Da LogP 2.47 TPSA 53.1 | ✓ Ro5 | ✓ Clean |
O=C(O)c1cc2cc(I)ccc2[nH]1
|
| ZINC12888311 | 0.632 | 260.3 Da LogP 3.32 TPSA 36.1 | ✓ Ro5 | ✓ Clean |
O=C(c1cc2cc(F)ccc2[nH]1)N1CCCCCC1
|
| ZINC32755156 | 0.632 | 246.3 Da LogP 2.93 TPSA 36.1 | ✓ Ro5 | ✓ Clean |
O=C(c1cc2cc(F)ccc2[nH]1)N1CCCCC1
|
| ZINC11956231 | 0.629 | 207.2 Da LogP 1.37 TPSA 70.2 | ✓ Ro5 | ✓ Clean |
O=C(O)c1cc2cc(F)ccc2[nH]c1=O
|
| ZINC1420704 | 0.629 | 207.2 Da LogP 1.37 TPSA 70.2 | ✓ Ro5 | ✓ Clean |
O=C(O)c1cc(=O)c2cc(F)ccc2[nH]1
|
| ZINC2384078 | 0.629 | 229.2 Da LogP 2.88 TPSA 53.1 | ✓ Ro5 | ✓ Clean |
O=C(O)c1cc2cc(C(F)(F)F)ccc2[nH]1
|
| ZINC14686440 | 0.625 | 436.4 Da LogP -2.64 TPSA 247.9 | 1 viol. | ✓ Clean |
O=C(O)C[C@](O)(CC(=O)NCCCCNC(=O)C[C@@](O)(CC(=O…
|
| ZINC14686442 | 0.625 | 436.4 Da LogP -2.64 TPSA 247.9 | 1 viol. | ✓ Clean |
O=C(O)C[C@@](O)(CC(=O)NCCCCNC(=O)C[C@](O)(CC(=O…
|
| ZINC14686444 | 0.625 | 436.4 Da LogP -2.64 TPSA 247.9 | 1 viol. | ✓ Clean |
O=C(O)C[C@@](O)(CC(=O)NCCCCNC(=O)C[C@@](O)(CC(=…
|
| ZINC398906 | 0.619 | 200.2 Da LogP 1.74 TPSA 74.6 | ✓ Ro5 | ✓ Clean |
O=C(O)C[C@H]1CCCC[C@@H]1CC(=O)O
|
| ZINC13007430 | 0.605 | 234.3 Da LogP 2.79 TPSA 36.1 | ✓ Ro5 | ✓ Clean |
CCN(CC)C(=O)c1cc2cc(F)ccc2[nH]1
|
| ZINC18736 | 0.605 | 207.2 Da LogP 2.48 TPSA 42.1 | ✓ Ro5 | ✓ Clean |
CCOC(=O)c1cc2cc(F)ccc2[nH]1
|
| ZINC20028329 | 0.605 | 220.2 Da LogP 2.45 TPSA 44.9 | ✓ Ro5 | ✓ Clean |
CC(C)NC(=O)c1cc2cc(F)ccc2[nH]1
|
| ZINC14985707 | 0.600 | 203.2 Da LogP 2.07 TPSA 70.2 | ✓ Ro5 | ✓ Clean |
CC(=O)c1ccc2[nH]c(C(=O)O)cc2c1
|
| ZINC20028330 | 0.600 | 261.3 Da LogP 1.69 TPSA 39.3 | ✓ Ro5 | ✓ Clean |
CN1CCN(C(=O)c2cc3cc(F)ccc3[nH]2)CC1
|
| ZINC2582700 | 0.600 | 217.3 Da LogP 3.16 TPSA 53.1 | ✓ Ro5 | ✓ Clean |
CC(C)(C)c1ccc2[nH]c(C(=O)O)cc2c1
|
| ZINC32003100 | 0.600 | 237.3 Da LogP 3.53 TPSA 53.1 | ✓ Ro5 | ✓ Clean |
O=C(O)c1cc2cc(-c3ccccc3)ccc2[nH]1
|
| ZINC40497239 | 0.600 | 268.3 Da LogP 3.58 TPSA 36.1 | ✓ Ro5 | ✓ Clean |
CN(C(=O)c1cc2cc(F)ccc2[nH]1)c1ccccc1
|
| ZINC82862565 | 0.600 | 210.2 Da LogP 2.83 TPSA 37.3 | ✓ Ro5 | ✓ Clean |
O=C(O)CC1CCC(C(F)(F)F)CC1
|
| ZINC5346714 | 0.595 | 282.3 Da LogP 3.58 TPSA 36.1 | ✓ Ro5 | ✓ Clean |
CN(Cc1ccccc1)C(=O)c1cc2cc(F)ccc2[nH]1
|
| ZINC19685918 | 0.593 | 225.3 Da LogP 2.51 TPSA 40.5 | ✓ Ro5 | ✓ Clean |
O=C(O)CC1CCN(C2CCCCC2)CC1
|
| ZINC584905838 | 0.593 | 200.4 Da LogP 2.97 TPSA 37.3 | ✓ Ro5 | ✓ Clean |
C[Si]1(C)CCC[C@@H](CC(=O)O)CC1
|
| ZINC584905839 | 0.593 | 200.4 Da LogP 2.97 TPSA 37.3 | ✓ Ro5 | ✓ Clean |
C[Si]1(C)CCC[C@H](CC(=O)O)CC1
|
| ZINC12946858 | 0.590 | 218.2 Da LogP 2.20 TPSA 44.9 | ✓ Ro5 | ✓ Clean |
O=C(NC1CC1)c1cc2cc(F)ccc2[nH]1
|
| ZINC32779849 | 0.590 | 222.2 Da LogP 1.94 TPSA 45.3 | ✓ Ro5 | ✓ Clean |
CON(C)C(=O)c1cc2cc(F)ccc2[nH]1
|
| ZINC13003350 | 0.585 | 234.3 Da LogP 2.84 TPSA 44.9 | ✓ Ro5 | ✓ Clean |
CC[C@@H](C)NC(=O)c1cc2cc(F)ccc2[nH]1
|
| ZINC13003352 | 0.585 | 234.3 Da LogP 2.84 TPSA 44.9 | ✓ Ro5 | ✓ Clean |
CC[C@H](C)NC(=O)c1cc2cc(F)ccc2[nH]1
|
| ZINC13957077 | 0.585 | 344.4 Da LogP 4.83 TPSA 44.9 | ✓ Ro5 | ✓ Clean |
O=C(NC(c1ccccc1)c1ccccc1)c1cc2cc(F)ccc2[nH]1
|
| ZINC5267168 | 0.585 | 268.3 Da LogP 3.24 TPSA 44.9 | ✓ Ro5 | ✓ Clean |
O=C(NCc1ccccc1)c1cc2cc(F)ccc2[nH]1
|
| ZINC5345841 | 0.585 | 341.4 Da LogP 3.41 TPSA 39.3 | ✓ Ro5 | ✓ Clean |
O=C(c1cc2cc(F)ccc2[nH]1)N1CCN(c2ccc(F)cc2)CC1
|
| ZINC95989650 | 0.585 | 262.2 Da LogP 1.65 TPSA 82.2 | ✓ Ro5 | ✓ Clean |
O=C(NC1(C(=O)O)CC1)c1cc2cc(F)ccc2[nH]1
|
| ZINC13821173 | 0.583 | 207.2 Da LogP 1.37 TPSA 70.2 | ✓ Ro5 | ✓ Clean |
O=C(O)c1cc(=O)c2ccc(F)cc2[nH]1
|
| ZINC3748658 | 0.583 | 203.2 Da LogP 2.99 TPSA 53.1 | ✓ Ro5 | ✓ Clean |
CC(C)c1ccc2[nH]c(C(=O)O)cc2c1
|
| ZINC161561 | 0.579 | 245.2 Da LogP 2.76 TPSA 62.3 | ✓ Ro5 | ✓ Clean |
O=C(O)c1cc2cc(OC(F)(F)F)ccc2[nH]1
|
| ZINC13398039 | 0.577 | 234.2 Da LogP -0.38 TPSA 121.1 | ✓ Ro5 | ✓ Clean |
CC(C)OC(=O)C[C@](O)(CC(=O)O)C(=O)O
|
| ZINC2528012 | 0.577 | 234.2 Da LogP -0.38 TPSA 121.1 | ✓ Ro5 | ✓ Clean |
CC(C)OC(=O)C[C@@](O)(CC(=O)O)C(=O)O
|
| ZINC12907968 | 0.575 | 260.2 Da LogP 2.60 TPSA 44.9 | ✓ Ro5 | ✓ Clean |
O=C(NCC(F)(F)F)c1cc2cc(F)ccc2[nH]1
|
| ZINC12978339 | 0.575 | 216.2 Da LogP 1.67 TPSA 44.9 | ✓ Ro5 | ✓ Clean |
C#CCNC(=O)c1cc2cc(F)ccc2[nH]1
|
PDB and ChEMBL records on this protein are shown in full. ChEMBL records from similar proteins are capped at the top 100 per protein (by pchembl) and ZINC at the top 50 (Tanimoto ≥ 0.5). ADME columns are descriptor-based screening flags, not experimental toxicity results.