Overview
Basic information about this protein and its source genome.
- Accession
- PA0266
- Gene
- davT PA0266
- Status
- annotated
- Amino acids
- 426
- Structure source
- AlphaFold
Target profile
Computed evidence for target prioritization.
- Human off-target
- hit
- Human identity (%)
- 35.616
- Human E-value
- 7.19e-24
- Gut microbiome off-target
- hit
- Essential (DEG)
- Y
- Localization
- Cytoplasmic
Selected Druggability evidence
Selected Druggability is the FPocket score chosen for ranking using the curated structure priority. The 3D viewer may show a different loaded structure, so its visible pockets can differ.
Sequence
Primary amino-acid sequence viewer.
Functional Annotations
Enzyme classification and Gene Ontology terms linked to this protein.
Enzyme Commission (EC)
1Gene Ontology (GO)
10- GO:0005829 The part of the cytoplasm that does not contain organelles but which does contain other particulate matter, such as protein complexes.
- GO:0034386 Catalysis of the reaction: 2-oxoglutarate + 4-aminobutanoate = L-glutamate + succinate semialdehyde.
- GO:0047589 Catalysis of the reaction: 5-aminopentanoate + 2-oxoglutarate = 5-oxopentanoate + L-glutamate.
- GO:0030170 Binding to pyridoxal 5' phosphate, 3-hydroxy-5-(hydroxymethyl)-2-methyl4-pyridine carboxaldehyde 5' phosphate, the biologically active form of vitamin B6.
- GO:0009450 The chemical reactions and pathways resulting in the breakdown of gamma-aminobutyric acid (GABA).
- GO:0019477 The chemical reactions and pathways resulting in the breakdown of L-lysine.
- GO:0003824 Catalysis of a biochemical reaction at physiological temperatures. In biologically catalyzed reactions, the reactants are known as substrates, and the catalysts are naturally occurring macromolecular substances known as enzymes. Enzymes possess specific binding sites for substrates, and are usually composed wholly or largely of protein, but RNA that has catalytic activity (ribozyme) is often also regarded as enzymatic.
- GO:0008483 Catalysis of the transfer of an amino group to an acceptor, usually a 2-oxo acid.
- GO:0009448 The chemical reactions and pathways involving gamma-aminobutyric acid (GABA, 4-aminobutyrate), an amino acid which acts as a neurotransmitter in some organisms.
- GO:0003867 OBSOLETE. Catalysis of the reaction: 4-aminobutanoate + amino group acceptor = succinate semialdehyde + amino acid.
Sequence Features
Domain/signature hits from InterPro and related databases.
Show feature table
| Start | End | DB | Term | Name |
|---|---|---|---|---|
| 10 | 421 | NCBIfam | TIGR00700 | 4-aminobutyrate--2-oxoglutarate transaminase |
| 10 | 421 | InterPro | IPR004632 | 4-aminobutyrate aminotransferase, bacterial |
| 60 | 319 | FunFam | G3DSA:3.40.640.10:FF:000013 | 4-aminobutyrate aminotransferase |
| 25 | 129 | PIRSF | PIRSF000521 | Transaminase_4ab_Lys_Orn |
| 25 | 129 | InterPro | IPR005814 | Aminotransferase class-III |
| 172 | 425 | PIRSF | PIRSF000521 | Transaminase_4ab_Lys_Orn |
| 172 | 425 | InterPro | IPR005814 | Aminotransferase class-III |
| 124 | 157 | PIRSF | PIRSF000521 | Transaminase_4ab_Lys_Orn |
| 124 | 157 | InterPro | IPR005814 | Aminotransferase class-III |
| 7 | 423 | PANTHER | PTHR11986 | AMINOTRANSFERASE CLASS III |
| 8 | 418 | Gene3D | G3DSA:3.90.1150.10 | Aspartate Aminotransferase, domain 1 |
| 8 | 418 | InterPro | IPR015422 | Pyridoxal phosphate-dependent transferase, small domain |
| 60 | 319 | Gene3D | G3DSA:3.40.640.10 | - |
| 60 | 319 | InterPro | IPR015421 | Pyridoxal phosphate-dependent transferase, major domain |
| 22 | 425 | SUPERFAMILY | SSF53383 | PLP-dependent transferases |
| 22 | 425 | InterPro | IPR015424 | Pyridoxal phosphate-dependent transferase |
| 17 | 421 | Pfam | PF00202 | Aminotransferase class-III |
| 17 | 421 | InterPro | IPR005814 | Aminotransferase class-III |
| 279 | 419 | FunFam | G3DSA:3.90.1150.10:FF:000022 | 4-aminobutyrate aminotransferase |
| 8 | 422 | CDD | cd00610 | OAT_like |
| 8 | 422 | InterPro | IPR005814 | Aminotransferase class-III |
| 237 | 274 | ProSitePatterns | PS00600 | Aminotransferases class-III pyridoxal-phosphate attachment site. |
| 237 | 274 | InterPro | IPR005814 | Aminotransferase class-III |
3D Structure
Selected loaded structure. Experimental PDB entries may cover only a portion of the sequence; predicted models typically cover the full protein.
Loading 3D structure...
Structural evidence
0 + 1Experimental PDB entries and predicted models. Click Switch to display a different structure in the viewer.
| Entry | Method | Resolution | Chain | Coverage | Links | Status |
|---|---|---|---|---|---|---|
|
AlphaFold
PA0266
|
AlphaFold | — | — | full sequence | — | Viewing |
Pocket details FPocket · P2Rank — toggle visibility and zoom from here, or open full viewer
Pockets (FPOCKET)
Showing top-ranked FPocket candidates by druggability. Druggability is color-coded: high (0.7 or higher), medium (0.4 to 0.69), low (below 0.4).
| FPOCKET | Sticks | Spheres | Surfaces | Druggability | Labels | Zoom | Positions |
|---|---|---|---|---|---|---|---|
| 3 | 0.363 | ||||||
| 1 | 0.31 |
Ligand evidence
Ligands grouped by evidence source. PDB ligands keep the source crystal visible, and loaded crystals can be opened directly in the structure viewer.
Highest-confidence structural evidence: ligands co-crystallized with this exact protein. If the source PDB is loaded in TPW, use Open crystal to inspect it in the structure viewer.
No PDB structure with a co-crystallized ligand found for this exact protein.
Structural evidence inferred from similar proteins. The source crystal indicates where the ligand was observed; the UniProt column identifies the homologous protein carrying that ligand.
| Ligand | Source crystal | UniProt (homolog) | MW · LogP · TPSA | Lipinski | PAINS | SMILES |
|---|---|---|---|---|---|---|
| ABU | A1R958 | 103.1 Da LogP -0.19 TPSA 63.3 | ✓ Ro5 | ✓ Clean |
C(CC(=O)O)CN
|
|
| IK2 | P22256 | 322.2 Da LogP -0.19 TPSA 158.4 | ✓ Ro5 | ✓ Clean |
Cc1c(c(c(cn1)COP(=O)(O)O)CNOCC(=O)O)O
|
|
| PLZ | Q8NT35 | 334.3 Da LogP 0.66 TPSA 149.2 | ✓ Ro5 | ✓ Clean |
Cc1c(c(c(cn1)COP(=O)(O)O)CNCCCC(=O)O)O
|
|
| PMP | P22256 | 248.2 Da LogP 0.16 TPSA 125.9 | ✓ Ro5 | ✓ Clean |
Cc1c(c(c(cn1)COP(=O)(O)O)CN)O
|
|
| SSN | A0QQ04 | 102.1 Da LogP 0.05 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
C(CC(=O)O)C=O
|
|
| TAR | D0CCF6 | 150.1 Da LogP -2.12 TPSA 115.1 | ✓ Ro5 | ✓ Clean |
[C@H]([C@@H](C(=O)O)O)(C(=O)O)O
|
Experimental bioactivity from ChEMBL measured directly on this protein. Score = pchembl (−log Ki/IC₅₀; higher = more potent).
No ChEMBL bioactivity data found for this exact protein.
Bioactivity inferred from similar proteins in ChEMBL. Score = pchembl (−log Ki/IC₅₀; higher = more potent).
No ChEMBL hits found through similar proteins.
Proposed virtual-screening candidates from ZINC. Score = Tanimoto similarity to a known binder (0–1; higher = more similar).
| Ligand | Tanimoto | MW · LogP · TPSA | Lipinski | PAINS | SMILES |
|---|---|---|---|---|---|
| ZINC13357569 | 0.778 | 243.4 Da LogP 3.71 TPSA 63.3 | ✓ Ro5 | ✓ Clean |
NCCCCCCCCCCCCCC(=O)O
|
| ZINC1763117 | 0.778 | 201.3 Da LogP 2.54 TPSA 63.3 | ✓ Ro5 | ✓ Clean |
NCCCCCCCCCCC(=O)O
|
| ZINC1845814 | 0.778 | 215.3 Da LogP 2.93 TPSA 63.3 | ✓ Ro5 | ✓ Clean |
NCCCCCCCCCCCC(=O)O
|
| ZINC22048354 | 0.778 | 229.4 Da LogP 3.32 TPSA 63.3 | ✓ Ro5 | ✓ Clean |
NCCCCCCCCCCCCC(=O)O
|
| ZINC34552398 | 0.778 | 257.4 Da LogP 4.10 TPSA 63.3 | ✓ Ro5 | ✓ Clean |
NCCCCCCCCCCCCCCC(=O)O
|
| ZINC34628306 | 0.778 | 271.4 Da LogP 4.49 TPSA 63.3 | ✓ Ro5 | ✓ Clean |
NCCCCCCCCCCCCCCCC(=O)O
|
| ZINC12359024 | 0.692 | 210.1 Da LogP -3.40 TPSA 155.5 | 1 viol. | ✓ Clean |
O=C(O)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C(=O)O
|
| ZINC13533920 | 0.692 | 210.1 Da LogP -3.40 TPSA 155.5 | 1 viol. | ✓ Clean |
O=C(O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)C(=O)O
|
| ZINC1532740 | 0.692 | 210.1 Da LogP -3.40 TPSA 155.5 | 1 viol. | ✓ Clean |
O=C(O)[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)C(=O)O
|
| ZINC1549593 | 0.692 | 210.1 Da LogP -3.40 TPSA 155.5 | 1 viol. | ✓ Clean |
O=C(O)[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)C(=O)O
|
| ZINC2013424 | 0.692 | 210.1 Da LogP -3.40 TPSA 155.5 | 1 viol. | ✓ Clean |
O=C(O)[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)O
|
| ZINC3581021 | 0.692 | 210.1 Da LogP -3.40 TPSA 155.5 | 1 viol. | ✓ Clean |
O=C(O)[C@H](O)[C@@H](O)[C@@H](O)[C@@H](O)C(=O)O
|
| ZINC3860635 | 0.692 | 210.1 Da LogP -3.40 TPSA 155.5 | 1 viol. | ✓ Clean |
O=C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)C(=O)O
|
| ZINC5783661 | 0.692 | 210.1 Da LogP -3.40 TPSA 155.5 | 1 viol. | ✓ Clean |
O=C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)O
|
| ZINC6072527 | 0.692 | 210.1 Da LogP -3.40 TPSA 155.5 | 1 viol. | ✓ Clean |
O=C(O)[C@@H](O)[C@@H](O)[C@@H](O)[C@@H](O)C(=O)O
|
| ZINC3074822 | 0.667 | 229.3 Da LogP 2.11 TPSA 80.4 | ✓ Ro5 | ✓ Clean |
NCCCCCC(=O)CCCCCC(=O)O
|
| ZINC4822737 | 0.667 | 313.5 Da LogP 4.45 TPSA 80.4 | ✓ Ro5 | ✓ Clean |
NCCCCCCCCCCCC(=O)CCCCCC(=O)O
|
| ZINC1532708 | 0.620 | 248.2 Da LogP 0.16 TPSA 125.9 | ✓ Ro5 | ✓ Clean |
Cc1ncc(COP(=O)(O)O)c(CN)c1O
|
| ZINC13512355 | 0.619 | 200.3 Da LogP 2.78 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
O=CCCCCCCCCCC(=O)O
|
| ZINC1532705 | 0.600 | 249.2 Da LogP 0.20 TPSA 120.1 | ✓ Ro5 | ✓ Clean |
Cc1ncc(COP(=O)(O)O)c(CO)c1O
|
| ZINC1529497 | 0.588 | 230.3 Da LogP 3.06 TPSA 74.6 | ✓ Ro5 | ✓ Clean |
O=C(O)CCCCCCCCCCC(=O)O
|
| ZINC1531045 | 0.588 | 202.2 Da LogP 2.28 TPSA 74.6 | ✓ Ro5 | ✓ Clean |
O=C(O)CCCCCCCCC(=O)O
|
| ZINC1560405156 | 0.588 | 208.1 Da LogP -1.79 TPSA 155.5 | 1 viol. | ✓ Clean |
O=C(O)/C(O)=C(\O)[C@H](O)[C@H](O)C(=O)O
|
| ZINC1560405157 | 0.588 | 208.1 Da LogP -1.79 TPSA 155.5 | 1 viol. | ✓ Clean |
O=C(O)/C(O)=C(/O)[C@H](O)[C@H](O)C(=O)O
|
| ZINC1593115 | 0.588 | 216.3 Da LogP 2.67 TPSA 74.6 | ✓ Ro5 | ✓ Clean |
O=C(O)CCCCCCCCCC(=O)O
|
| ZINC1700020 | 0.588 | 244.3 Da LogP 3.45 TPSA 74.6 | ✓ Ro5 | ✓ Clean |
O=C(O)CCCCCCCCCCCC(=O)O
|
| ZINC3860440 | 0.588 | 258.4 Da LogP 3.84 TPSA 74.6 | ✓ Ro5 | ✓ Clean |
O=C(O)CCCCCCCCCCCCC(=O)O
|
| ZINC3861298 | 0.588 | 286.4 Da LogP 4.62 TPSA 74.6 | ✓ Ro5 | ✓ Clean |
O=C(O)CCCCCCCCCCCCCCC(=O)O
|
| ZINC5113062 | 0.588 | 272.4 Da LogP 4.23 TPSA 74.6 | ✓ Ro5 | ✓ Clean |
O=C(O)CCCCCCCCCCCCCC(=O)O
|
| ZINC40470158 | 0.577 | 216.3 Da LogP 0.49 TPSA 92.4 | ✓ Ro5 | ✓ Clean |
NCCCC(=O)NCCCCCC(=O)O
|
| ZINC2114966 | 0.576 | 332.2 Da LogP 0.99 TPSA 149.5 | ✓ Ro5 | ✓ Clean |
Cc1ncc(COP(=O)(O)O)c(/C=N/CCCC(=O)O)c1O
|
| ZINC1656021 | 0.571 | 233.2 Da LogP 1.01 TPSA 99.9 | ✓ Ro5 | ✓ Clean |
Cc1ncc(COP(=O)(O)O)c(C)c1O
|
| ZINC78311249 | 0.565 | 203.3 Da LogP -0.54 TPSA 92.6 | ✓ Ro5 | ✓ Clean |
NCCCN(CCCN)CCC(=O)O
|
| ZINC13433578 | 0.550 | 201.3 Da LogP 1.68 TPSA 80.4 | ✓ Ro5 | ✓ Clean |
NC(=O)CCCCCCCCC(=O)O
|
| ZINC201768036 | 0.542 | 279.3 Da LogP -0.12 TPSA 100.2 | ✓ Ro5 | ✓ Clean |
NCCOCCOCCOCCOCCCC(=O)O
|
| ZINC1532514 | 0.538 | 247.1 Da LogP 0.52 TPSA 117.0 | ✓ Ro5 | ✓ Clean |
Cc1ncc(COP(=O)(O)O)c(C=O)c1O
|
| ZINC1703342 | 0.526 | 202.2 Da LogP 1.07 TPSA 91.7 | ✓ Ro5 | ✓ Clean |
O=C(O)CCCC(=O)CCCC(=O)O
|
| ZINC2508031 | 0.526 | 230.3 Da LogP 1.85 TPSA 91.7 | ✓ Ro5 | ✓ Clean |
O=C(O)CCCCC(=O)CCCCC(=O)O
|
| ZINC13526937 | 0.519 | 357.5 Da LogP 1.94 TPSA 121.5 | ✓ Ro5 | ✓ Clean |
NCCCCCC(=O)NCCCCCC(=O)NCCCCCC(=O)O
|
| ZINC1532906 | 0.519 | 244.3 Da LogP 1.27 TPSA 92.4 | ✓ Ro5 | ✓ Clean |
NCCCCCC(=O)NCCCCCC(=O)O
|
| ZINC40479778 | 0.519 | 272.4 Da LogP 2.05 TPSA 92.4 | ✓ Ro5 | ✓ Clean |
NCCCCCCC(=O)NCCCCCCC(=O)O
|
| ZINC1529331 | 0.500 | 206.1 Da LogP -2.21 TPSA 149.2 | ✓ Ro5 | ✓ Clean |
O=C(O)C(=O)[C@H](C(=O)O)[C@@H](O)C(=O)O
|
| ZINC1529334 | 0.500 | 206.1 Da LogP -2.21 TPSA 149.2 | ✓ Ro5 | ✓ Clean |
O=C(O)C(=O)[C@@H](C(=O)O)[C@H](O)C(=O)O
|
| ZINC26897400 | 0.500 | 286.4 Da LogP 3.41 TPSA 91.7 | ✓ Ro5 | ✓ Clean |
O=C(O)CCCCCCC(=O)CCCCCCC(=O)O
|
| ZINC3074813 | 0.500 | 258.3 Da LogP 2.63 TPSA 91.7 | ✓ Ro5 | ✓ Clean |
O=C(O)CCCCCC(=O)CCCCCC(=O)O
|
| ZINC34423725 | 0.500 | 342.5 Da LogP 4.97 TPSA 91.7 | ✓ Ro5 | ✓ Clean |
O=C(O)CCCCCCCCC(=O)CCCCCCCCC(=O)O
|
| ZINC4822898 | 0.500 | 272.3 Da LogP 3.02 TPSA 91.7 | ✓ Ro5 | ✓ Clean |
O=C(O)CCCCCCC(=O)CCCCCC(=O)O
|
| ZINC4822900 | 0.500 | 300.4 Da LogP 3.80 TPSA 91.7 | ✓ Ro5 | ✓ Clean |
O=C(O)CCCCCCCCC(=O)CCCCCC(=O)O
|
| ZINC79832968 | 0.500 | 203.2 Da LogP 0.82 TPSA 100.6 | ✓ Ro5 | ✓ Clean |
NC(CCCC(=O)O)CCCC(=O)O
|
| ZINC82505156 | 0.500 | 215.3 Da LogP -0.57 TPSA 69.8 | ✓ Ro5 | ✓ Clean |
NCCCN1CCN(CCC(=O)O)CC1
|
PDB and ChEMBL records on this protein are shown in full. ChEMBL records from similar proteins are capped at the top 100 per protein (by pchembl) and ZINC at the top 50 (Tanimoto ≥ 0.5). ADME columns are descriptor-based screening flags, not experimental toxicity results.