Overview
Basic information about this protein and its source genome.
- Accession
- PA4601
- Gene
- PA4601 morA
- Status
- annotated
- Amino acids
- 1415
- Structure source
- Experimental + AlphaFold
Target profile
Computed evidence for target prioritization.
- Human off-target
- No hit
- Gut microbiome off-target
- hit
- Essential (DEG)
- N
- Localization
- CytoplasmicMembrane
Selected Druggability evidence
Selected Druggability is the FPocket score chosen for ranking using the curated structure priority. The 3D viewer may show a different loaded structure, so its visible pockets can differ.
Sequence
Primary amino-acid sequence viewer.
Functional Annotations
Enzyme classification and Gene Ontology terms linked to this protein.
Enzyme Commission (EC)
1Gene Ontology (GO)
10- GO:0005886 The membrane surrounding a cell that separates the cell from its external environment. It consists of a phospholipid bilayer and associated proteins.
- GO:0071111 Catalysis of the reaction: cyclic di-3',5'-guanylate + H2O = 5'-phosphoguanylyl(3'->5')guanosine + H+.
- GO:0052621 Catalysis of the reaction: 2 GTP = cyclic di-3',5'-guanylate + 2 diphosphate + 2 H+.
- GO:0042802 Binding to an identical protein or proteins.
- GO:0046872 Binding to a metal ion.
- GO:0000166 Binding to a nucleotide, any compound consisting of a nucleoside that is esterified with (ortho)phosphate or an oligophosphate at any hydroxyl group on the ribose or deoxyribose.
- GO:0061939 Any process that mediates the transfer of information from one cell to another using c-di-GMP as the signal.
- GO:0071732 Any process that results in a change in state or activity of a cell (in terms of movement, secretion, enzyme production, gene expression, etc.) as a result of a nitric oxide stimulus.
- GO:0006355 Any process that modulates the frequency, rate or extent of cellular DNA-templated transcription.
- GO:0005515 Binding to a protein.
Sequence Features
Domain/signature hits from InterPro and related databases.
Show feature table
| Start | End | DB | Term | Name |
|---|---|---|---|---|
| 246 | 271 | Phobius | TRANSMEMBRANE | Region of a membrane-bound protein predicted to be embedded in the membrane. |
| 802 | 854 | ProSiteProfiles | PS50113 | PAC domain profile. |
| 802 | 854 | InterPro | IPR000700 | PAS-associated, C-terminal |
| 49 | 69 | Coils | Coil | Coil |
| 855 | 979 | Gene3D | G3DSA:3.30.450.20 | PAS domain |
| 922 | 976 | ProSiteProfiles | PS50113 | PAC domain profile. |
| 922 | 976 | InterPro | IPR000700 | PAS-associated, C-terminal |
| 973 | 1145 | FunFam | G3DSA:3.30.70.270:FF:000001 | Diguanylate cyclase domain protein |
| 842 | 965 | SUPERFAMILY | SSF55785 | PYP-like sensor domain (PAS domain) |
| 842 | 965 | InterPro | IPR035965 | PAS domain superfamily |
| 480 | 579 | SUPERFAMILY | SSF55785 | PYP-like sensor domain (PAS domain) |
| 480 | 579 | InterPro | IPR035965 | PAS domain superfamily |
| 850 | 1405 | PANTHER | PTHR44757 | DIGUANYLATE CYCLASE DGCP |
| 594 | 702 | CDD | cd00130 | PAS |
| 594 | 702 | InterPro | IPR000014 | PAS domain |
| 865 | 966 | Pfam | PF13426 | PAS domain |
| 865 | 966 | InterPro | IPR000014 | PAS domain |
| 729 | 844 | Pfam | PF13426 | PAS domain |
| 729 | 844 | InterPro | IPR000014 | PAS domain |
| 419 | 577 | Gene3D | G3DSA:3.30.450.20 | PAS domain |
| 967 | 1143 | SMART | SM00267 | duf1_3 |
| 967 | 1143 | InterPro | IPR000160 | GGDEF domain |
| 290 | 331 | ProSiteProfiles | PS50112 | PAS repeat profile. |
| 290 | 331 | InterPro | IPR000014 | PAS domain |
| 280 | 417 | Gene3D | G3DSA:3.30.450.20 | PAS domain |
| 1159 | 1394 | Pfam | PF00563 | EAL domain |
| 1159 | 1394 | InterPro | IPR001633 | EAL domain |
| 43 | 245 | Phobius | CYTOPLASMIC_DOMAIN | Region of a membrane-bound protein predicted to be outside the membrane, in the cytoplasm. |
| 975 | 1141 | NCBIfam | TIGR00254 | diguanylate cyclase (GGDEF) domain |
| 975 | 1141 | InterPro | IPR000160 | GGDEF domain |
| 978 | 1139 | Pfam | PF00990 | Diguanylate cyclase, GGDEF domain |
| 978 | 1139 | InterPro | IPR000160 | GGDEF domain |
| 1 | 20 | MobiDBLite | mobidb-lite | consensus disorder prediction |
| 569 | 703 | SUPERFAMILY | SSF55785 | PYP-like sensor domain (PAS domain) |
| 569 | 703 | InterPro | IPR035965 | PAS domain superfamily |
| 582 | 658 | ProSiteProfiles | PS50112 | PAS repeat profile. |
| 582 | 658 | InterPro | IPR000014 | PAS domain |
| 1154 | 1408 | FunFam | G3DSA:3.20.20.450:FF:000001 | Cyclic di-GMP phosphodiesterase yahA |
| 1 | 23 | Phobius | NON_CYTOPLASMIC_DOMAIN | Region of a membrane-bound protein predicted to be outside the membrane, in the extracellular region. |
| 980 | 1149 | Gene3D | G3DSA:3.30.70.270 | - |
| 980 | 1149 | InterPro | IPR043128 | Reverse transcriptase/Diguanylate cyclase domain |
| 661 | 714 | ProSiteProfiles | PS50113 | PAC domain profile. |
| 661 | 714 | InterPro | IPR000700 | PAS-associated, C-terminal |
| 1153 | 1399 | SMART | SM00052 | duf2_2 |
| 1153 | 1399 | InterPro | IPR001633 | EAL domain |
| 862 | 964 | CDD | cd00130 | PAS |
| 862 | 964 | InterPro | IPR000014 | PAS domain |
| 1 | 18 | MobiDBLite | mobidb-lite | consensus disorder prediction |
| 1154 | 1408 | ProSiteProfiles | PS50883 | EAL domain profile. |
| 1154 | 1408 | InterPro | IPR001633 | EAL domain |
| 1159 | 1399 | CDD | cd01948 | EAL |
| 1159 | 1399 | InterPro | IPR001633 | EAL domain |
| 983 | 1144 | SUPERFAMILY | SSF55073 | Nucleotide cyclase |
| 983 | 1144 | InterPro | IPR029787 | Nucleotide cyclase |
| 707 | 843 | SUPERFAMILY | SSF55785 | PYP-like sensor domain (PAS domain) |
| 707 | 843 | InterPro | IPR035965 | PAS domain superfamily |
| 292 | 358 | SMART | SM00091 | pas_2 |
| 292 | 358 | InterPro | IPR000014 | PAS domain |
| 853 | 920 | SMART | SM00091 | pas_2 |
| 853 | 920 | InterPro | IPR000014 | PAS domain |
| 717 | 784 | SMART | SM00091 | pas_2 |
| 717 | 784 | InterPro | IPR000014 | PAS domain |
| 584 | 653 | SMART | SM00091 | pas_2 |
| 584 | 653 | InterPro | IPR000014 | PAS domain |
| 715 | 755 | ProSiteProfiles | PS50112 | PAS repeat profile. |
| 715 | 755 | InterPro | IPR000014 | PAS domain |
| 851 | 897 | ProSiteProfiles | PS50112 | PAS repeat profile. |
| 851 | 897 | InterPro | IPR000014 | PAS domain |
| 855 | 979 | FunFam | G3DSA:3.30.450.20:FF:000172 | Cyclic di-GMP phosphodiesterase Gmr |
| 305 | 349 | Pfam | PF13188 | PAS domain |
| 305 | 349 | InterPro | IPR000014 | PAS domain |
| 272 | 1415 | Phobius | NON_CYTOPLASMIC_DOMAIN | Region of a membrane-bound protein predicted to be outside the membrane, in the extracellular region. |
| 1158 | 1405 | SUPERFAMILY | SSF141868 | EAL domain-like |
| 1158 | 1405 | InterPro | IPR035919 | EAL domain superfamily |
| 1154 | 1408 | Gene3D | G3DSA:3.20.20.450 | EAL domain |
| 1154 | 1408 | InterPro | IPR035919 | EAL domain superfamily |
| 803 | 845 | SMART | SM00086 | pac_2 |
| 803 | 845 | InterPro | IPR001610 | PAC motif |
| 925 | 967 | SMART | SM00086 | pac_2 |
| 925 | 967 | InterPro | IPR001610 | PAC motif |
| 662 | 705 | SMART | SM00086 | pac_2 |
| 662 | 705 | InterPro | IPR001610 | PAC motif |
| 1008 | 1145 | ProSiteProfiles | PS50887 | GGDEF domain profile. |
| 1008 | 1145 | InterPro | IPR000160 | GGDEF domain |
| 726 | 842 | CDD | cd00130 | PAS |
| 726 | 842 | InterPro | IPR000014 | PAS domain |
| 979 | 1141 | CDD | cd01949 | GGDEF |
| 979 | 1141 | InterPro | IPR000160 | GGDEF domain |
| 578 | 703 | Gene3D | G3DSA:3.30.450.20 | PAS domain |
| 581 | 712 | NCBIfam | TIGR00229 | PAS domain S-box protein |
| 581 | 712 | InterPro | IPR000014 | PAS domain |
| 713 | 852 | NCBIfam | TIGR00229 | PAS domain S-box protein |
| 713 | 852 | InterPro | IPR000014 | PAS domain |
| 857 | 973 | NCBIfam | TIGR00229 | PAS domain S-box protein |
| 857 | 973 | InterPro | IPR000014 | PAS domain |
| 24 | 42 | Phobius | TRANSMEMBRANE | Region of a membrane-bound protein predicted to be embedded in the membrane. |
| 715 | 854 | Gene3D | G3DSA:3.30.450.20 | PAS domain |
| 246 | 268 | TMHMM | TMhelix | Region of a membrane-bound protein predicted to be embedded in the membrane. |
| 608 | 699 | Pfam | PF08447 | PAS fold |
| 608 | 699 | InterPro | IPR013655 | PAS fold-3 |
| 23 | 42 | TMHMM | TMhelix | Region of a membrane-bound protein predicted to be embedded in the membrane. |
| 283 | 381 | SUPERFAMILY | SSF55785 | PYP-like sensor domain (PAS domain) |
| 283 | 381 | InterPro | IPR035965 | PAS domain superfamily |
3D Structure
Selected loaded structure. Experimental PDB entries may cover only a portion of the sequence; predicted models typically cover the full protein.
Loading 3D structure...
Structural evidence
4 + 1Experimental PDB entries and predicted models. Click Switch to display a different structure in the viewer.
| Entry | Method | Resolution | Chain | Coverage | Links | Status |
|---|---|---|---|---|---|---|
|
PDB
4RNH
|
X-ray | 2.45 Å | A |
|
Viewing | |
|
PDB
4RNF
|
X-ray | 2.85 Å | A |
|
Loaded | |
|
PDB
4RNI
|
X-ray | 2.17 Å | A,B |
|
Loaded | |
|
PDB
4RNJ
|
X-ray | 2.32 Å | A,B |
|
Loaded | |
|
AlphaFold
PA4601
|
AlphaFold | — | — | full sequence | — | Loaded |
Pocket details FPocket · P2Rank — toggle visibility and zoom from here, or open full viewer
Pockets (FPOCKET)
Showing top-ranked FPocket candidates by druggability. Druggability is color-coded: high (0.7 or higher), medium (0.4 to 0.69), low (below 0.4).
| FPOCKET | Sticks | Spheres | Surfaces | Druggability | Labels | Zoom | Positions |
|---|---|---|---|---|---|---|---|
| 5 | 0.902 | ||||||
| 2 | 0.602 | ||||||
| 4 | 0.586 | ||||||
| 1 | 0.572 |
Ligand evidence
Ligands grouped by evidence source. PDB ligands keep the source crystal visible, and loaded crystals can be opened directly in the structure viewer.
Highest-confidence structural evidence: ligands co-crystallized with this exact protein. If the source PDB is loaded in TPW, use Open crystal to inspect it in the structure viewer.
| Ligand | Source crystal | MW · LogP · TPSA | Lipinski | PAINS | SMILES |
|---|---|---|---|---|---|
| C2E | 690.4 Da LogP -3.05 TPSA 349.6 | 3 viol. | ✓ Clean |
c1nc2c(n1[C@H]3[C@@H]([C@H]4[C@H](O3)CO[P@@](=O…
|
Structural evidence inferred from similar proteins. The source crystal indicates where the ligand was observed; the UniProt column identifies the homologous protein carrying that ligand.
Experimental bioactivity from ChEMBL measured directly on this protein. Score = pchembl (−log Ki/IC₅₀; higher = more potent).
No ChEMBL bioactivity data found for this exact protein.
Bioactivity inferred from similar proteins in ChEMBL. Score = pchembl (−log Ki/IC₅₀; higher = more potent).
No ChEMBL hits found through similar proteins.
Proposed virtual-screening candidates from ZINC. Score = Tanimoto similarity to a known binder (0–1; higher = more similar).
| Ligand | Tanimoto | MW · LogP · TPSA | Lipinski | PAINS | SMILES |
|---|---|---|---|---|---|
| ZINC100022626 | 1.000 | 212.3 Da LogP 4.16 TPSA 37.3 | ✓ Ro5 | ✓ Clean |
CCCCCCCCCC/C=C\C(=O)O
|
| ZINC12501894 | 1.000 | 345.2 Da LogP -1.52 TPSA 174.8 | ✓ Ro5 | ✓ Clean |
Nc1nc2c(ncn2[C@@H]2O[C@@H]3CO[P@](=O)(O)O[C@@H]…
|
| ZINC1529498 | 1.000 | 200.3 Da LogP 3.99 TPSA 37.3 | ✓ Ro5 | ✓ Clean |
CCCCCCCCCCCC(=O)O
|
| ZINC1530417 | 1.000 | 228.4 Da LogP 4.77 TPSA 37.3 | ✓ Ro5 | ✓ Clean |
CCCCCCCCCCCCCC(=O)O
|
| ZINC1628119 | 1.000 | 214.3 Da LogP 4.38 TPSA 37.3 | ✓ Ro5 | ✓ Clean |
CCCCCCCCCCCCC(=O)O
|
| ZINC1693736 | 1.000 | 212.3 Da LogP 4.16 TPSA 37.3 | ✓ Ro5 | ✓ Clean |
CCCCCCCCCC/C=C/C(=O)O
|
| ZINC2039111479 | 1.000 | 212.3 Da LogP 4.16 TPSA 37.3 | ✓ Ro5 | ✓ Clean |
CCCCCCCCCCC=CC(=O)O
|
| ZINC32838980 | 1.000 | 226.4 Da LogP 4.55 TPSA 37.3 | ✓ Ro5 | ✓ Clean |
CCCCCCCCCCC/C=C/C(=O)O
|
| ZINC33494013 | 1.000 | 345.2 Da LogP -1.52 TPSA 174.8 | ✓ Ro5 | ✓ Clean |
Nc1nc2c(ncn2[C@@H]2O[C@@H]3CO[P@](=O)(O)O[C@@H]…
|
| ZINC4095501 | 1.000 | 345.2 Da LogP -1.52 TPSA 174.8 | ✓ Ro5 | ✓ Clean |
Nc1nc2c(ncn2[C@@H]2O[C@@H]3CO[P@](=O)(O)O[C@H]3…
|
| ZINC88465990 | 1.000 | 345.2 Da LogP -1.52 TPSA 174.8 | ✓ Ro5 | ✓ Clean |
Nc1nc2c(ncn2[C@@H]2O[C@@H]3CO[P@@](=O)(O)O[C@H]…
|
| ZINC138457918 | 0.850 | 228.3 Da LogP 3.56 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCCCCC(=O)CCCCC(=O)O
|
| ZINC138458029 | 0.850 | 228.3 Da LogP 3.56 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCCCC(=O)CCCCCC(=O)O
|
| ZINC144395054 | 0.850 | 242.4 Da LogP 3.95 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCCC(=O)CCCCCCCC(=O)O
|
| ZINC14619628 | 0.850 | 270.4 Da LogP 4.73 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCCC(=O)CCCCCCCCCC(=O)O
|
| ZINC196749828 | 0.850 | 214.3 Da LogP 3.17 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCCCC(=O)CCCCC(=O)O
|
| ZINC2113934076 | 0.850 | 256.4 Da LogP 4.34 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCCCC(=O)CCCCCCCC(=O)O
|
| ZINC2113934082 | 0.850 | 256.4 Da LogP 4.34 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCCCCC(=O)CCCCCCC(=O)O
|
| ZINC2113934083 | 0.850 | 256.4 Da LogP 4.34 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCCCCCCC(=O)CCCCC(=O)O
|
| ZINC2243670 | 0.850 | 228.3 Da LogP 3.56 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCCC(=O)CCCCCCC(=O)O
|
| ZINC2569203 | 0.850 | 214.3 Da LogP 3.17 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCCC(=O)CCCCCC(=O)O
|
| ZINC4798470 | 0.850 | 270.4 Da LogP 4.73 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCCCC(=O)CCCCCCCCC(=O)O
|
| ZINC5973005 | 0.850 | 242.4 Da LogP 3.95 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCCCC(=O)CCCCCCC(=O)O
|
| ZINC71418182 | 0.850 | 270.4 Da LogP 4.73 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCCCCCCCC(=O)CCCCC(=O)O
|
| ZINC79244776 | 0.850 | 270.4 Da LogP 4.73 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCCCCC(=O)CCCCCCCC(=O)O
|
| ZINC86037082 | 0.850 | 270.4 Da LogP 4.73 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCCCCCCC(=O)CCCCCC(=O)O
|
| ZINC86037089 | 0.850 | 270.4 Da LogP 4.73 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCCCCCC(=O)CCCCCCC(=O)O
|
| ZINC86039283 | 0.850 | 242.4 Da LogP 3.95 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCCCCCC(=O)CCCCC(=O)O
|
| ZINC3160730 | 0.810 | 214.3 Da LogP 3.17 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCCCCC(=O)CCCC(=O)O
|
| ZINC4582907 | 0.810 | 200.3 Da LogP 2.78 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCCCC(=O)CCCC(=O)O
|
| ZINC4727003 | 0.810 | 312.4 Da LogP 4.69 TPSA 71.4 | ✓ Ro5 | ✓ Clean |
CCCCCCC(=O)CCC(=O)CCCCCCCC(=O)O
|
| ZINC86037074 | 0.810 | 270.4 Da LogP 4.73 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCCCCCCCCC(=O)CCCC(=O)O
|
| ZINC2378801 | 0.800 | 200.3 Da LogP 2.78 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCCC(=O)CCCCC(=O)O
|
| ZINC2113934081 | 0.762 | 270.4 Da LogP 4.73 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCC(=O)CCCCCCCCCCC(=O)O
|
| ZINC2243668 | 0.762 | 214.3 Da LogP 3.17 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCC(=O)CCCCCCC(=O)O
|
| ZINC2378799 | 0.762 | 200.3 Da LogP 2.78 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCC(=O)CCCCCC(=O)O
|
| ZINC33820423 | 0.762 | 242.4 Da LogP 3.95 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCC(=O)CCCCCCCCC(=O)O
|
| ZINC4095503 | 0.746 | 330.2 Da LogP -1.11 TPSA 148.8 | ✓ Ro5 | ✓ Clean |
O=c1[nH]cnc2c1ncn2[C@@H]1O[C@@H]2CO[P@](=O)(O)O…
|
| ZINC4533542 | 0.746 | 330.2 Da LogP -1.11 TPSA 148.8 | ✓ Ro5 | ✓ Clean |
O=c1[nH]cnc2c1ncn2[C@H]1O[C@H]2CO[P@](=O)(O)O[C…
|
| ZINC4533545 | 0.746 | 330.2 Da LogP -1.11 TPSA 148.8 | ✓ Ro5 | ✓ Clean |
O=c1[nH]cnc2c1ncn2[C@H]1O[C@H]2CO[P@](=O)(O)O[C…
|
| ZINC2387442 | 0.739 | 246.4 Da LogP 4.34 TPSA 37.3 | ✓ Ro5 | ✓ Clean |
CCCCCCCCSCCCCC(=O)O
|
| ZINC31778284 | 0.739 | 310.4 Da LogP 4.47 TPSA 71.4 | ✓ Ro5 | ✓ Clean |
CCCCCCC(=O)/C=C\C(=O)CCCCCCCC(=O)O
|
| ZINC5540108 | 0.739 | 310.4 Da LogP 4.47 TPSA 71.4 | ✓ Ro5 | ✓ Clean |
CCCCCCC(=O)/C=C/C(=O)CCCCCCCC(=O)O
|
| ZINC64633397 | 0.739 | 226.4 Da LogP 4.55 TPSA 37.3 | ✓ Ro5 | ✓ Clean |
CCCCCC/C=C\CCCCCC(=O)O
|
| ZINC59545317 | 0.727 | 200.3 Da LogP 2.78 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCCCCC(=O)CCC(=O)O
|
| ZINC59545320 | 0.727 | 270.4 Da LogP 4.73 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCCCCCCCCCC(=O)CCC(=O)O
|
| ZINC59545336 | 0.727 | 214.3 Da LogP 3.17 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCCCCCCCC(=O)CCC(=O)O
|
| ZINC13508826 | 0.708 | 272.4 Da LogP 4.52 TPSA 57.5 | ✓ Ro5 | ✓ Clean |
CCCCCC[C@H](O)CCCCCCCCC(=O)O
|
| ZINC14454563 | 0.708 | 286.5 Da LogP 4.91 TPSA 57.5 | ✓ Ro5 | ✓ Clean |
CCCCCC[C@@H](O)CCCCCCCCCC(=O)O
|
| ZINC14454564 | 0.708 | 286.5 Da LogP 4.91 TPSA 57.5 | ✓ Ro5 | ✓ Clean |
CCCCCC[C@H](O)CCCCCCCCCC(=O)O
|
PDB and ChEMBL records on this protein are shown in full. ChEMBL records from similar proteins are capped at the top 100 per protein (by pchembl) and ZINC at the top 50 (Tanimoto ≥ 0.5). ADME columns are descriptor-based screening flags, not experimental toxicity results.