Overview
Basic information about this protein and its source genome.
- Accession
- VK055_5120
- Gene
- AIK83646.1 irp1
- Status
- annotated
- Amino acids
- 3163
- Structure source
- Unavailable
Target profile
Computed evidence for target prioritization.
- Human off-target
- hit
- Human identity (%)
- 31.071
- Human E-value
- 1.44e-25
- Gut microbiome off-target
- hit
- Essential (DEG)
- N
- DEG identity (%)
- 39.261
- Localization
- CytoplasmicMembrane
Sequence
Primary amino-acid sequence viewer.
Functional Annotations
Enzyme classification and Gene Ontology terms linked to this protein.
Gene Ontology (GO)
13- GO:0003824 Catalysis of a biochemical reaction at physiological temperatures. In biologically catalyzed reactions, the reactants are known as substrates, and the catalysts are naturally occurring macromolecular substances known as enzymes. Enzymes possess specific binding sites for substrates, and are usually composed wholly or largely of protein, but RNA that has catalytic activity (ribozyme) is often also regarded as enzymatic.
- GO:0016740 Catalysis of the transfer of a group, e.g. a methyl group, glycosyl group, acyl group, phosphorus-containing, or other groups, from one compound (generally regarded as the donor) to another compound (generally regarded as the acceptor). Transferase is the systematic name for any enzyme of EC class 2.
- GO:0004315 Catalysis of the reaction: acyl-[acyl-carrier protein] + malonyl-[acyl-carrier protein] = 3-oxoacyl-[acyl-carrier protein] + CO2 + [acyl-carrier protein].
- GO:0031177 Binding to phosphopantetheine, the vitamin pantetheine 4'-(dihydrogen phosphate).
- GO:0006633 The chemical reactions and pathways resulting in the formation of a fatty acid, any of the aliphatic monocarboxylic acids that can be liberated by hydrolysis from naturally occurring fats and oils. Fatty acids are predominantly straight-chain acids of 4 to 24 carbon atoms, which may be saturated or unsaturated; branched fatty acids and hydroxy fatty acids also occur, and very long chain acids of over 30 carbons are found in waxes.
- GO:0009058 A cellular process consisting of the biochemical pathways by which a living organism synthesizes chemical substances. This typically represents the energy-requiring part of metabolism in which simpler substances are transformed into more complex ones.
- GO:0016746 Catalysis of the transfer of an acyl group from one compound (donor) to another (acceptor).
- GO:0005737 The contents of a cell excluding the plasma membrane and nucleus, but including other subcellular structures.
- GO:0005886 The membrane surrounding a cell that separates the cell from its external environment. It consists of a phospholipid bilayer and associated proteins.
- GO:0004312 Catalysis of the reaction: acetyl-CoA + n malonyl-CoA + 2n NADPH + 2n H+ = long-chain fatty acid + n+1 CoA + n CO2 + 2n NADP+.
- GO:0016874 Catalysis of the joining of two molecules, or two groups within a single molecule, using the energy from the hydrolysis of ATP, a similar triphosphate, or a pH gradient.
- GO:0071770 The aggregation, arrangement and bonding together of a set of components, including (phenyl)phthiocerol, phthiodiolone, phthiotriol dimycocerosate and diphthioceranate, to form the DIM/DIP layer of the Actinobacterium-type cell wall.
- GO:0009403 The chemical reactions and pathways resulting in the formation of toxin, a poisonous compound (typically a protein) that is produced by cells or organisms and that can cause disease when introduced into the body or tissues of an organism.
Sequence Features
Domain/signature hits from InterPro and related databases.
Show feature table
| Start | End | DB | Term | Name |
|---|---|---|---|---|
| 1817 | 1928 | SUPERFAMILY | SSF47336 | ACP-like |
| 1817 | 1928 | InterPro | IPR036736 | ACP-like superfamily |
| 23 | 447 | SUPERFAMILY | SSF53901 | Thiolase-like |
| 23 | 447 | InterPro | IPR016039 | Thiolase-like |
| 1910 | 2088 | FunFam | G3DSA:3.30.559.10:FF:000023 | Non-ribosomal peptide synthetase |
| 2805 | 2826 | MobiDBLite | mobidb-lite | consensus disorder prediction |
| 1915 | 2341 | CDD | cd19535 | Cyc_NRPS |
| 551 | 846 | Pfam | PF00698 | Acyl transferase domain |
| 551 | 846 | InterPro | IPR014043 | Acyl transferase |
| 1818 | 1902 | Gene3D | G3DSA:1.10.1200.10 | - |
| 1818 | 1902 | InterPro | IPR036736 | ACP-like superfamily |
| 1823 | 1889 | Pfam | PF00550 | Phosphopantetheine attachment site |
| 1823 | 1889 | InterPro | IPR009081 | Phosphopantetheine binding ACP domain |
| 2832 | 2894 | Pfam | PF00550 | Phosphopantetheine attachment site |
| 2832 | 2894 | InterPro | IPR009081 | Phosphopantetheine binding ACP domain |
| 3163 | 3163 | Coils | Coil | Coil |
| 2853 | 2868 | ProSitePatterns | PS00012 | Phosphopantetheine attachment site. |
| 2853 | 2868 | InterPro | IPR006162 | Phosphopantetheine attachment site |
| 1818 | 1893 | ProSiteProfiles | PS50075 | Carrier protein (CP) domain profile. |
| 1818 | 1893 | InterPro | IPR009081 | Phosphopantetheine binding ACP domain |
| 1435 | 1776 | CDD | cd05274 | KR_FAS_SDR_x |
| 1911 | 2109 | SUPERFAMILY | SSF52777 | CoA-dependent acyltransferases |
| 550 | 835 | SUPERFAMILY | SSF52151 | FabD/lysophospholipase-like |
| 550 | 835 | InterPro | IPR016035 | Acyl transferase/acyl hydrolase/lysophospholipase |
| 2095 | 2347 | Gene3D | G3DSA:3.30.559.30 | Nonribosomal peptide synthetase, condensation domain |
| 29 | 452 | SMART | SM00825 | Beta-ketoacyl synthase |
| 29 | 452 | InterPro | IPR020841 | Polyketide synthase, beta-ketoacyl synthase domain |
| 23 | 496 | FunFam | G3DSA:3.40.47.10:FF:000042 | Polyketide synthase Pks13 |
| 1948 | 2262 | Pfam | PF00668 | Condensation domain |
| 1948 | 2262 | InterPro | IPR001242 | Condensation domain |
| 2813 | 2902 | Gene3D | G3DSA:1.10.1200.10 | - |
| 2813 | 2902 | InterPro | IPR036736 | ACP-like superfamily |
| 1558 | 1731 | SMART | SM00822 | This enzymatic domain is part of bacterial polyketide synthases and catalyses the first step in the reductive modification of the beta-carbonyl centres in the growing polyketide chain. It uses NADPH to reduce the keto group to a hydroxy group. |
| 2098 | 2343 | SUPERFAMILY | SSF52777 | CoA-dependent acyltransferases |
| 2898 | 3152 | SUPERFAMILY | SSF53474 | alpha/beta-Hydrolases |
| 2898 | 3152 | InterPro | IPR029058 | Alpha/Beta hydrolase fold |
| 553 | 844 | SMART | SM00827 | Acyl transferase domain in polyketide synthase (PKS) enzymes. |
| 553 | 844 | InterPro | IPR014043 | Acyl transferase |
| 27 | 447 | CDD | cd00833 | PKS |
| 404 | 515 | Pfam | PF16197 | Ketoacyl-synthetase C-terminal extension |
| 404 | 515 | InterPro | IPR032821 | Polyketide synthase, C-terminal extension |
| 2918 | 3152 | SMART | SM00824 | Thioesterase |
| 2918 | 3152 | InterPro | IPR020802 | Polyketide synthase, thioesterase domain |
| 551 | 847 | Gene3D | G3DSA:3.40.366.10 | - |
| 551 | 847 | InterPro | IPR001227 | Acyl transferase domain superfamily |
| 1848 | 1863 | ProSitePatterns | PS00012 | Phosphopantetheine attachment site. |
| 1848 | 1863 | InterPro | IPR006162 | Phosphopantetheine attachment site |
| 27 | 276 | Pfam | PF00109 | Beta-ketoacyl synthase, N-terminal domain |
| 27 | 276 | InterPro | IPR014030 | Beta-ketoacyl synthase, N-terminal |
| 2830 | 2898 | SMART | SM00823 | Phosphopantetheine attachment site |
| 2830 | 2898 | InterPro | IPR020806 | Polyketide synthase, phosphopantetheine-binding domain |
| 1821 | 1893 | SMART | SM00823 | Phosphopantetheine attachment site |
| 1821 | 1893 | InterPro | IPR020806 | Polyketide synthase, phosphopantetheine-binding domain |
| 2915 | 3006 | Pfam | PF00975 | Thioesterase domain |
| 2915 | 3006 | InterPro | IPR001031 | Thioesterase |
| 1435 | 1455 | Coils | Coil | Coil |
| 1384 | 1541 | SUPERFAMILY | SSF51735 | NAD(P)-binding Rossmann-fold domains |
| 1384 | 1541 | InterPro | IPR036291 | NAD(P)-binding domain superfamily |
| 19 | 473 | Gene3D | G3DSA:3.40.47.10 | - |
| 19 | 473 | InterPro | IPR016039 | Thiolase-like |
| 675 | 736 | SUPERFAMILY | SSF55048 | Probable ACP-binding domain of malonyl-CoA ACP transacylase |
| 675 | 736 | InterPro | IPR016036 | Malonyl-CoA ACP transacylase, ACP-binding |
| 1060 | 1250 | SUPERFAMILY | SSF53335 | S-adenosyl-L-methionine-dependent methyltransferases |
| 1060 | 1250 | InterPro | IPR029063 | S-adenosyl-L-methionine-dependent methyltransferase superfamily |
| 2574 | 2750 | SUPERFAMILY | SSF53335 | S-adenosyl-L-methionine-dependent methyltransferases |
| 2574 | 2750 | InterPro | IPR029063 | S-adenosyl-L-methionine-dependent methyltransferase superfamily |
| 2905 | 3157 | Gene3D | G3DSA:3.40.50.1820 | alpha/beta hydrolase |
| 2905 | 3157 | InterPro | IPR029058 | Alpha/Beta hydrolase fold |
| 997 | 1255 | Gene3D | G3DSA:3.40.50.150 | Vaccinia Virus protein VP39 |
| 997 | 1255 | InterPro | IPR029063 | S-adenosyl-L-methionine-dependent methyltransferase superfamily |
| 2447 | 2767 | Gene3D | G3DSA:3.40.50.150 | Vaccinia Virus protein VP39 |
| 2447 | 2767 | InterPro | IPR029063 | S-adenosyl-L-methionine-dependent methyltransferase superfamily |
| 1560 | 1729 | Pfam | PF08659 | KR domain |
| 1560 | 1729 | InterPro | IPR013968 | Polyketide synthase, ketoreductase domain |
| 474 | 890 | Gene3D | G3DSA:3.30.70.3290 | - |
| 26 | 449 | ProSiteProfiles | PS52004 | Ketosynthase family 3 (KS3) domain profile. |
| 26 | 449 | InterPro | IPR020841 | Polyketide synthase, beta-ketoacyl synthase domain |
| 2824 | 2898 | ProSiteProfiles | PS50075 | Carrier protein (CP) domain profile. |
| 2824 | 2898 | InterPro | IPR009081 | Phosphopantetheine binding ACP domain |
| 2828 | 2894 | SUPERFAMILY | SSF47336 | ACP-like |
| 2828 | 2894 | InterPro | IPR036736 | ACP-like superfamily |
| 2096 | 2343 | FunFam | G3DSA:3.30.559.30:FF:000006 | Yersiniabactin polyketide/non-ribosomal peptide synthetase |
| 1093 | 1194 | Pfam | PF08242 | Methyltransferase domain |
| 1093 | 1194 | InterPro | IPR013217 | Methyltransferase type 12 |
| 2593 | 2693 | Pfam | PF08242 | Methyltransferase domain |
| 2593 | 2693 | InterPro | IPR013217 | Methyltransferase type 12 |
| 1557 | 1786 | SUPERFAMILY | SSF51735 | NAD(P)-binding Rossmann-fold domains |
| 1557 | 1786 | InterPro | IPR036291 | NAD(P)-binding domain superfamily |
| 1762 | 3021 | PANTHER | PTHR43775 | FATTY ACID SYNTHASE |
| 285 | 401 | Pfam | PF02801 | Beta-ketoacyl synthase, C-terminal domain |
| 285 | 401 | InterPro | IPR014031 | Beta-ketoacyl synthase, C-terminal |
| 189 | 205 | ProSitePatterns | PS00606 | Ketosynthase family 3 (KS3) active site signature. |
| 189 | 205 | InterPro | IPR018201 | Beta-ketoacyl synthase, active site |
| 1910 | 2090 | Gene3D | G3DSA:3.30.559.10 | - |
| 1910 | 2090 | InterPro | IPR023213 | Chloramphenicol acetyltransferase-like domain superfamily |
| 1346 | 1795 | Gene3D | G3DSA:3.40.50.720 | - |
Ligand evidence
Ligands grouped by evidence source. PDB ligands keep the source crystal visible, and loaded crystals can be opened directly in the structure viewer.
Highest-confidence structural evidence: ligands co-crystallized with this exact protein. If the source PDB is loaded in TPW, use Open crystal to inspect it in the structure viewer.
No PDB structure with a co-crystallized ligand found for this exact protein.
Structural evidence inferred from similar proteins. The source crystal indicates where the ligand was observed; the UniProt column identifies the homologous protein carrying that ligand.
| Ligand | Source crystal | UniProt (homolog) | MW · LogP · TPSA | Lipinski | PAINS | SMILES |
|---|---|---|---|---|---|---|
| 57H | Q03133 | 122.1 Da LogP 0.35 TPSA 57.5 | ✓ Ro5 | ✓ Clean |
C=CCP(=O)(O)O
|
|
| 8H6 | Q93NW7 | 390.5 Da LogP -0.14 TPSA 132.8 | ✓ Ro5 | ✓ Clean |
CCC(=O)[C@@H](C)C(=O)SCCNC(=O)CCNC(=O)[C@@H](C(…
|
|
| AKG | Q6DNF2 | 146.1 Da LogP -0.50 TPSA 91.7 | ✓ Ro5 | ✓ Clean |
C(CC(=O)O)C(=O)C(=O)O
|
|
| DUV | A0A0E3JLZ0 | 154.2 Da LogP 0.69 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
C#CCCCC(C=O)C(=O)O
|
|
| DUW | A0A0E3JLZ0 | 178.2 Da LogP 1.13 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
c1ccc(cc1)C[C@H](C=O)C(=O)O
|
|
| E5U | Q8KUH4 | 134.1 Da LogP -0.83 TPSA 83.8 | ✓ Ro5 | ✓ Clean |
COC(C(=O)O)C(=O)O
|
|
| LMR | Q93NW7 | 134.1 Da LogP -1.09 TPSA 94.8 | ✓ Ro5 | ✓ Clean |
C([C@@H](C(=O)O)O)C(=O)O
|
|
| MLT | Q93NW7 | 134.1 Da LogP -1.09 TPSA 94.8 | ✓ Ro5 | ✓ Clean |
C([C@H](C(=O)O)O)C(=O)O
|
|
| PNS | Q6DNF2 | 358.4 Da LogP -0.96 TPSA 145.2 | 1 viol. | ✓ Clean |
CC(C)(COP(=O)(O)O)[C@H](C(=O)NCCC(=O)NCCS)O
|
Experimental bioactivity from ChEMBL measured directly on this protein. Score = pchembl (−log Ki/IC₅₀; higher = more potent).
No ChEMBL bioactivity data found for this exact protein.
Bioactivity inferred from similar proteins in ChEMBL. Score = pchembl (−log Ki/IC₅₀; higher = more potent).
No ChEMBL hits found through similar proteins.
Proposed virtual-screening candidates from ZINC. Score = Tanimoto similarity to a known binder (0–1; higher = more similar).
| Ligand | Tanimoto | MW · LogP · TPSA | Lipinski | PAINS | SMILES |
|---|---|---|---|---|---|
| ZINC71773889 | 0.667 | 206.1 Da LogP -1.77 TPSA 132.1 | ✓ Ro5 | ✓ Clean |
O=C(C[C@H](O)C(=O)O)C[C@H](O)C(=O)O
|
| ZINC71773890 | 0.667 | 206.1 Da LogP -1.77 TPSA 132.1 | ✓ Ro5 | ✓ Clean |
O=C(C[C@H](O)C(=O)O)C[C@@H](O)C(=O)O
|
| ZINC71773891 | 0.667 | 206.1 Da LogP -1.77 TPSA 132.1 | ✓ Ro5 | ✓ Clean |
O=C(C[C@@H](O)C(=O)O)C[C@@H](O)C(=O)O
|
| ZINC31938448 | 0.656 | 266.3 Da LogP 3.25 TPSA 34.1 | ✓ Ro5 | ✓ Clean |
O=C[C@@H](Cc1ccccc1)C(=O)CCc1ccccc1
|
| ZINC31938449 | 0.656 | 266.3 Da LogP 3.25 TPSA 34.1 | ✓ Ro5 | ✓ Clean |
O=C[C@H](Cc1ccccc1)C(=O)CCc1ccccc1
|
| ZINC3869683 | 0.643 | 278.4 Da LogP -1.08 TPSA 98.7 | ✓ Ro5 | ✓ Clean |
CC(C)(CO)[C@H](O)C(=O)NCCC(=O)NCCS
|
| ZINC3869684 | 0.643 | 278.4 Da LogP -1.08 TPSA 98.7 | ✓ Ro5 | ✓ Clean |
CC(C)(CO)[C@@H](O)C(=O)NCCC(=O)NCCS
|
| ZINC73739659 | 0.636 | 206.2 Da LogP 1.61 TPSA 43.4 | ✓ Ro5 | ✓ Clean |
CCOC(=O)[C@H](C=O)Cc1ccccc1
|
| ZINC73739661 | 0.636 | 206.2 Da LogP 1.61 TPSA 43.4 | ✓ Ro5 | ✓ Clean |
CCOC(=O)[C@@H](C=O)Cc1ccccc1
|
| ZINC27644247 | 0.618 | 230.3 Da LogP 0.09 TPSA 111.2 | ✓ Ro5 | ✓ Clean |
CCCCNC(=N)NCCC[C@H](N)C(=O)O
|
| ZINC196899382 | 0.588 | 228.2 Da LogP -0.14 TPSA 92.4 | ✓ Ro5 | ✓ Clean |
N[C@@H](CCCNC(=O)C(F)(F)F)C(=O)O
|
| ZINC4155291 | 0.583 | 216.2 Da LogP -1.37 TPSA 130.8 | ✓ Ro5 | ✓ Clean |
CC(=O)/N=C(\N)NCCC[C@H](N)C(=O)O
|
| ZINC4155299 | 0.583 | 216.2 Da LogP -1.37 TPSA 130.8 | ✓ Ro5 | ✓ Clean |
CC(=O)/N=C(\N)NCCC[C@@H](N)C(=O)O
|
| ZINC1529718 | 0.571 | 202.3 Da LogP -0.74 TPSA 102.4 | ✓ Ro5 | ✓ Clean |
CN(C)C(=N)NCCC[C@H](N)C(=O)O
|
| ZINC1546170 | 0.571 | 216.3 Da LogP -0.30 TPSA 111.2 | ✓ Ro5 | ✓ Clean |
CCCNC(=N)NCCC[C@H](N)C(=O)O
|
| ZINC1693352 | 0.571 | 240.3 Da LogP 3.17 TPSA 37.3 | ✓ Ro5 | ✓ Clean |
O=C(O)C(Cc1ccccc1)Cc1ccccc1
|
| ZINC2560273 | 0.571 | 202.3 Da LogP -0.69 TPSA 111.2 | ✓ Ro5 | ✓ Clean |
CCNC(=N)NCCC[C@H](N)C(=O)O
|
| ZINC35874629 | 0.571 | 224.3 Da LogP 3.29 TPSA 17.1 | ✓ Ro5 | ✓ Clean |
O=CC(Cc1ccccc1)Cc1ccccc1
|
| ZINC4543782 | 0.571 | 202.3 Da LogP -0.74 TPSA 102.4 | ✓ Ro5 | ✓ Clean |
CN(C)C(=N)NCCC[C@@H](N)C(=O)O
|
| ZINC7997269 | 0.571 | 205.3 Da LogP 0.07 TPSA 99.2 | ✓ Ro5 | ✓ Clean |
CSC(=N)NCCC[C@@H](N)C(=O)O
|
| ZINC144076260 | 0.559 | 232.2 Da LogP -0.84 TPSA 129.7 | ✓ Ro5 | ✓ Clean |
N[C@@H](CCCCNC(=O)CC(=O)O)C(=O)O
|
| ZINC218922593 | 0.559 | 204.2 Da LogP -1.32 TPSA 112.6 | ✓ Ro5 | ✓ Clean |
N[C@@H](CCCCNC(=O)CO)C(=O)O
|
| ZINC2516116 | 0.559 | 275.3 Da LogP -1.12 TPSA 155.7 | ✓ Ro5 | ✓ Clean |
N[C@@H](CCCCNC(=O)CC[C@H](N)C(=O)O)C(=O)O
|
| ZINC4545887 | 0.559 | 275.3 Da LogP -1.12 TPSA 155.7 | ✓ Ro5 | ✓ Clean |
N[C@@H](CCCCNC(=O)CC[C@@H](N)C(=O)O)C(=O)O
|
| ZINC4545888 | 0.559 | 275.3 Da LogP -1.12 TPSA 155.7 | ✓ Ro5 | ✓ Clean |
N[C@@H](CCC(=O)NCCCC[C@@H](N)C(=O)O)C(=O)O
|
| ZINC4545889 | 0.559 | 275.3 Da LogP -1.12 TPSA 155.7 | ✓ Ro5 | ✓ Clean |
N[C@H](CCCCNC(=O)CC[C@@H](N)C(=O)O)C(=O)O
|
| ZINC50027904 | 0.559 | 261.3 Da LogP -1.51 TPSA 155.7 | ✓ Ro5 | ✓ Clean |
N[C@@H](CCCCNC(=O)C[C@H](N)C(=O)O)C(=O)O
|
| ZINC12503853 | 0.556 | 201.3 Da LogP 0.55 TPSA 99.2 | ✓ Ro5 | ✓ Clean |
CCCC(=N)NCCC[C@H](N)C(=O)O
|
| ZINC1640080 | 0.556 | 232.3 Da LogP 0.70 TPSA 101.6 | ✓ Ro5 | ✓ Clean |
CC(C)(C)OC(=O)NCCC[C@H](N)C(=O)O
|
| ZINC217503161 | 0.556 | 230.3 Da LogP 0.88 TPSA 92.4 | ✓ Ro5 | ✓ Clean |
CCCCC(=O)NCCCC[C@H](N)C(=O)O
|
| ZINC2560765 | 0.556 | 232.3 Da LogP 0.70 TPSA 101.6 | ✓ Ro5 | ✓ Clean |
CC(C)(C)OC(=O)NCCC[C@@H](N)C(=O)O
|
| ZINC3055005 | 0.556 | 204.2 Da LogP -0.63 TPSA 126.6 | ✓ Ro5 | ✓ Clean |
N[C@@H](CCCC[C@H](N)C(=O)O)C(=O)O
|
| ZINC3055007 | 0.556 | 204.2 Da LogP -0.63 TPSA 126.6 | ✓ Ro5 | ✓ Clean |
N[C@@H](CCCC[C@@H](N)C(=O)O)C(=O)O
|
| ZINC3055010 | 0.556 | 204.2 Da LogP -0.63 TPSA 126.6 | ✓ Ro5 | ✓ Clean |
N[C@H](CCCC[C@@H](N)C(=O)O)C(=O)O
|
| ZINC675038108 | 0.556 | 231.3 Da LogP -1.49 TPSA 123.3 | 1 viol. | ✓ Clean |
CNC(NC)C(=N)NCCC[C@H](N)C(=O)O
|
| ZINC100017163 | 0.553 | 213.3 Da LogP 0.71 TPSA 99.2 | ✓ Ro5 | ✓ Clean |
C/C=C/CC(=N)NCCC[C@H](N)C(=O)O
|
| ZINC19796052 | 0.553 | 219.2 Da LogP -1.73 TPSA 156.9 | ✓ Ro5 | ✓ Clean |
N/C(=N\[N+](=O)[O-])NCCC[C@H](N)C(=O)O
|
| ZINC21982226 | 0.553 | 219.2 Da LogP -1.73 TPSA 156.9 | ✓ Ro5 | ✓ Clean |
N/C(=N\[N+](=O)[O-])NCCC[C@@H](N)C(=O)O
|
| ZINC5113209 | 0.548 | 275.3 Da LogP -0.26 TPSA 138.7 | ✓ Ro5 | ✓ Clean |
N[C@@H](CCCCNCCCC[C@H](N)C(=O)O)C(=O)O
|
| ZINC13545298 | 0.543 | 202.3 Da LogP 0.09 TPSA 92.4 | ✓ Ro5 | ✓ Clean |
CCC(=O)NCCCC[C@H](N)C(=O)O
|
| ZINC216616240 | 0.543 | 430.5 Da LogP 0.72 TPSA 184.8 | 1 viol. | ✓ Clean |
N[C@@H](CCCCNC(=O)CCCCCCC(=O)NCCCC[C@H](N)C(=O)…
|
| ZINC6360447 | 0.543 | 222.3 Da LogP 0.37 TPSA 75.3 | ✓ Ro5 | ✓ Clean |
N[C@H](CCCCNC(=S)S)C(=O)O
|
| ZINC1530092 | 0.541 | 254.2 Da LogP -1.61 TPSA 168.8 | 1 viol. | ✓ Clean |
N=C(NCCC[C@H](N)C(=O)O)NP(=O)(O)O
|
| ZINC230402790 | 0.541 | 214.3 Da LogP 0.26 TPSA 92.4 | ✓ Ro5 | ✓ Clean |
C/C=C/C(=O)NCCCC[C@H](N)C(=O)O
|
| ZINC237993466 | 0.541 | 214.3 Da LogP 0.26 TPSA 92.4 | ✓ Ro5 | ✓ Clean |
C/C=C/C(=O)NCCCC[C@@H](N)C(=O)O
|
| ZINC2509855 | 0.541 | 216.2 Da LogP 0.09 TPSA 101.6 | ✓ Ro5 | ✓ Clean |
C=CCOC(=O)NCCC[C@H](N)C(=O)O
|
| ZINC5965908 | 0.541 | 202.3 Da LogP -1.03 TPSA 99.7 | ✓ Ro5 | ✓ Clean |
C/N=C(\NC)NCCC[C@H](N)C(=O)O
|
| ZINC98044182 | 0.541 | 216.2 Da LogP 0.09 TPSA 101.6 | ✓ Ro5 | ✓ Clean |
C=CCOC(=O)NCCC[C@@H](N)C(=O)O
|
| ZINC1555366 | 0.536 | 232.3 Da LogP 0.15 TPSA 126.6 | ✓ Ro5 | ✓ Clean |
N[C@@H](CCCCCC[C@H](N)C(=O)O)C(=O)O
|
| ZINC1555369 | 0.536 | 232.3 Da LogP 0.15 TPSA 126.6 | ✓ Ro5 | ✓ Clean |
N[C@H](CCCCCC[C@@H](N)C(=O)O)C(=O)O
|
PDB and ChEMBL records on this protein are shown in full. ChEMBL records from similar proteins are capped at the top 100 per protein (by pchembl) and ZINC at the top 50 (Tanimoto ≥ 0.5). ADME columns are descriptor-based screening flags, not experimental toxicity results.
3D Structure
No structural model is available for this protein.
Structure unavailable
No pre-computed model was found in the AlphaFold database and no ColabFold prediction is available for this protein.