Target candidate with partial support; inspect missing evidence before prioritizing.
Automated synthesis of the evidence currently loaded. Review the underlying records before prioritizing this protein.
Main supporting evidence
Risks to review
Terms and data sources used on this page
PDB: experimentally determined structures from the Protein Data Bank. These are the strongest structural evidence, but may cover only part of the protein.
AlphaFold DB model: a precomputed predicted structure downloaded from AlphaFold Database/UniProt, not an experiment performed here.
ColabFold model: a predicted structure generated for this workspace; interpret it with coverage and confidence.
pLDDT: confidence score for predicted structures. High values support local geometry; low values mean the region should not drive pocket interpretation.
FPocket / P2Rank: software tools that predict possible ligand-binding pockets on a 3D structure. They are useful screening signals, not experimental validation.
Druggability: a pocket-based estimate of whether a small molecule could bind productively. It does not mean a drug already exists.
PDB ligand: a compound observed in an experimental structure. Direct same-protein records are stronger than homolog-transferred records.
ChEMBL: a public database of measured compound bioactivity. Direct entries are stronger than entries transferred from similar proteins.
ZINC: a purchasable-compound database. Here it marks proposed candidates from chemical similarity, not measured binders.
LigQ / LigQ_2: an internal Target pipeline step that gathers PDB, ChEMBL, and ZINC ligand evidence for each protein.
Off-target: sequence similarity to proteins we prefer not to hit, such as human proteins or beneficial gut microbiome proteins.
DEG: Database of Essential Genes. A match suggests the protein resembles genes known to be essential in other organisms.
Roary / CoreCruncher: pan-genome tools used to decide whether a gene is core across analyzed strains or accessory/strain-specific.
EC / GO: functional annotations: EC describes enzyme reactions; GO describes biological process, molecular function, or cellular component.
KEGG pathway: a curated metabolic route label used here to group reactions imported from the metabolic model.
Chokepoint: a metabolic reaction that is the only producer or consumer of a metabolite in the imported model.
Prioritization evidence
Selectivity, essentiality, structural confidence, conservation, and predicted binding-site evidence.
Off-target risk
- Human off-target
- Hit
- Human identity (%)
- 31.071 Lower values reduce human off-target concern.
- Human E-value
- 1.44e-25
- Gut microbiome similarity
- 0.1% of screened genomes Lower prevalence suggests narrower overlap with the screened gut microbiome.
Essentiality
- Essential (DEG)
- N
- DEG identity (%)
- 39.261 Higher values support similarity to known essential genes.
Sequence
Primary amino-acid sequence viewer.
MDNLRFSSAPTADSIDASIAQHYPDCEPVAVIGYACHFPESPDGETFWQNLLEGRECSRRFTREELLAVGLDAAIIDDPHYVNIGTVLDNADCFDATLFGYSRQEAESMDPQQRLFLQAVWHALEHAGYAPGAVPHKTGVFASSRMSTYPGREALNVTEVAQVKGLQSLMGNDKDYIATRAAYKLNLHGPALSVQTACSSSLVAVHLACESLRAGESDMAVAGGVALSFPQQAGYRYQPGMIFSPDGHCRPFDASAEGTWAGNGLGCVVLRRLRDALLSGDPIISVILSSAVNNDGNRKVGYTAPSVAGQQAVIEEALMLAAIDDRQVGYIETHGTGTPLGDAIEIEALRNVYAPRPQDQRCALGSVKSNMGHLDTAAGIAGLLKTVLAVSRGQIPPLLNFHTPNPALKLEESPFTIPVSAQAWQDEMRYAGVSSFGIGGTNCHMIVASLPDALNARLPNTDSGRKSTALLLSAASDSALRRLATDYAGALRENADASSLAFTALHARRLDLPFRLAAPLNRETAEALSAWAGEKSGALVYSGHGASGKQVWLFTGQGSHWRTMGQTMYQHSTAFADTLDRCFSACSEMLTPSLREAMFNPDSAQLDNMAWAQPAIVAFEIAMAAHWRAEGLKPDFAIGHSVGEFAAAVVCGHYTIEQVMPLVCRRGALMQQCASGAMVAVFADEDTLMPLARQFELDLAANNGTQHTVFSGPEARLAVFCATLSQHDINYRRLSVTGAAHSALLEPILDRFQDACAGLHAEPGQIPIISTLTADVIDESTLNQADYWRRHMRQPVRFIQSIQVAHQLGARVFLEMGPDAQLVACGQREYRDNAYWIASARRNKEASDVLNQALLQLYAAGVALPWADLLAGDGQRIAAPCYPFDTERYWKERVSPACEPADAALSAGLEVASRAATALDLPRLEALKQCATRLHAIYVDQLVQRCTGDAIENGVDAMTIMRRGRLLPRYQQLLQRLLNNCVVDGDYRCTDGRYVRARPIEHQQRESLLTELAGYCEGFQAIPDTIARAGDRLYEMMSGAEEPVAIIFPQSASDGVEVLYQEFSFGRYFNQIAAGVLRGIVQTRQPRQPLRILEVGGGTGGTTAWLLPELNGVPALEYHFTDISALFTRRAQQKFADYDFVKYSELDLEKEAQSQGFQAQSYDLIVAANVIHATRHIGRTLDNLRPLLKPGGRLLMREITQPMRLFDFVFGPLVLPLQDLDAREGELFLTTAQWQQQCRHAGFSKVAWLPQDGSPTAGMSEHIILATLPGQAVSAVTFTAPSEPVLGQALTDNGDYLADWSDCAGQPERFNARWQEAWRLLSQRHGDALPVEPPPVAAPEWLGKVRLSWQNEAFSRGQMRVEARHPTGEWLPLSPAAPLPAPQTHYQWRWTPLNVASIDQLLTFSFSAGTLARSDELAQYGIIHDPHASSRLMIVEESEDTLALAEKVIAALTASAAGLIVVTRRAWRVEENEALSASHHALWALLRVAANEQPERLLAAIDLAENTPWETLHQGLSAVSLSQRWLAARGDTLWLPSLAPQTGCAAELPANVFTGDSRWHLVTGAFGGLGRLAVNWLREKGARRIALLAPRVDESWLRDVEGGQTRVCRCDVGDAGQLATVLDDLAANGGIAGAIHAAGVLADAPLQELDDHQLAAVFAVKAQAASQLLQTLRNHDGRYLILYSSAAATLGAPGQSAHALACGYLDGLAQQFSTLDAPKTLSVAWGAWGESGRAATPEMLATLASRGMGALSDAEGCWHLEQAVMRGAPWRLAMRVFTDKMPPLQQALFNISATEKAATPVIPPADDNAFNGSLSDETAVMAWLKKRIAVQLRLSDPASLHPNQDLLQLGMDSLLFLELSSDIQHYLGVRINAERAWQDLSPHGLTQLICSKPEATPAASQPEVLRHDADERYAPFPLTPIQHAYWLGRTHLIGYGGVACHVLFEWDKRHDEFDLAILEKAWNQLIARHDMLRMVVDADGQQRILATTPEYHIPRDDLRALSPEEQRIALEKRRHELSYRVLPADQWPLFELVVSEIDDCHYRLHMNLDLLQFDVQSFKVMMDDLAQVWRGETLAPLAITFRDYVMAEQARRQTSAWHDAWDYWQEKLPQLPLAPALPVVETPPETPHFTTFKSTIGKTEWQAVKQRWQQQGVTPSAALLTLFAATLERWSRTTTFTLNLTFFNRQPIHPQINQLIGDFTSVTLVDFNFSAPVTLQDQMQQTQQRLWQNMAHSEMNGVEVIRELGRLRGSQRQPLMPVVFTSMLGMTLEGMTIDQAMSHLFGEPCYVFTQTPQVWLDHQVMESDGELMFSWYCMDNVLEPGAAEAMFNDYCAILQAVIAAPESLKTLASGIAGHIPRRRWPLNAQADYDLRDIEQATLEYPGIRQARAEITEQGALTLDIVMADDPSPSAAMPDEHELTQLALPLPEQAQLDELEATWRWLEARALQGIAATLNRHGLFTTPEIAHRFSAIVQALSAQASHQRLLRQWLQCLTERKWLIREGESWRCRIPLSEIPEPQDACPQSQWSQALAQYLETCIARHDGLFSGQCSPLELLFNEQHRVTDALYRDNPASVCLNRYTAQIAALCSAERILEVGAGTAATTAPVLKATRNTRQSYHFTDVSAQFLNDARARFHDESQVSYALFDINQPLDFTAHPEAGYDLIVAVNVLHDASHVVQTLRRLKLLLKAGGRLLIVEATERNSVFQLASVGFIEGLSGYRDFRRRDEKPMLTRSAWQEVLVQAGFANELAWPAQESSPLRQHLLVARSPGVNRPDKKAVSRYLQQRFGTGLPILQIRQREALFTPLHAPSDAPTEPAKPTPVAGGNPALEKQVAELWQSLLSRPVARHHDFFELGGDSLMATRMVAQLNRRGIARANLQDLFSHSTLSDFCAHLQAATSGEDNPIPLCQGDGEETLFVFHASDGDISAWLPLASALNRRVFGLQAKSPQRFATLDQMIDEYVGCIRRQQPHGPYVLAGWSYGAFLAAGAAQRLYAKGEQVRMVLIDPVCRQDFCCENRAALLRLLAEGQTPLALPEHFDQQTPDSQLADFISLAKTAGMVSQNLTLQAAETWLDNIAHLLRLLTEHTPGESVPVPCLMVYAAGRPARWTPAETEWQGWINNADDAVIEASHWQIMMEAPHVQACAQHITRWLCATSTQPENTL
Functional annotations
Enzyme classification and Gene Ontology terms linked to this protein.
Subcellular localization
- Localization
- CytoplasmicMembrane
Gene Ontology (GO)
13- GO:0003824 Catalysis of a biochemical reaction at physiological temperatures. In biologically catalyzed reactions, the reactants are known as substrates, and the catalysts are naturally occurring macromolecular substances known as enzymes. Enzymes possess specific binding sites for substrates, and are usually composed wholly or largely of protein, but RNA that has catalytic activity (ribozyme) is often also regarded as enzymatic.
- GO:0016740 Catalysis of the transfer of a group, e.g. a methyl group, glycosyl group, acyl group, phosphorus-containing, or other groups, from one compound (generally regarded as the donor) to another compound (generally regarded as the acceptor). Transferase is the systematic name for any enzyme of EC class 2.
- GO:0004315 Catalysis of the reaction: acyl-[acyl-carrier protein] + malonyl-[acyl-carrier protein] = 3-oxoacyl-[acyl-carrier protein] + CO2 + [acyl-carrier protein].
- GO:0031177 Binding to phosphopantetheine, the vitamin pantetheine 4'-(dihydrogen phosphate).
- GO:0006633 The chemical reactions and pathways resulting in the formation of a fatty acid, any of the aliphatic monocarboxylic acids that can be liberated by hydrolysis from naturally occurring fats and oils. Fatty acids are predominantly straight-chain acids of 4 to 24 carbon atoms, which may be saturated or unsaturated; branched fatty acids and hydroxy fatty acids also occur, and very long chain acids of over 30 carbons are found in waxes.
- GO:0009058 A cellular process consisting of the biochemical pathways by which a living organism synthesizes chemical substances. This typically represents the energy-requiring part of metabolism in which simpler substances are transformed into more complex ones.
- GO:0016746 Catalysis of the transfer of an acyl group from one compound (donor) to another (acceptor).
- GO:0005737 The contents of a cell excluding the plasma membrane and nucleus, but including other subcellular structures.
- GO:0005886 The membrane surrounding a cell that separates the cell from its external environment. It consists of a phospholipid bilayer and associated proteins.
- GO:0004312 Catalysis of the reaction: acetyl-CoA + n malonyl-CoA + 2n NADPH + 2n H+ = long-chain fatty acid + n+1 CoA + n CO2 + 2n NADP+.
- GO:0016874 Catalysis of the joining of two molecules, or two groups within a single molecule, using the energy from the hydrolysis of ATP, a similar triphosphate, or a pH gradient.
- GO:0071770 The aggregation, arrangement and bonding together of a set of components, including (phenyl)phthiocerol, phthiodiolone, phthiotriol dimycocerosate and diphthioceranate, to form the DIM/DIP layer of the Actinobacterium-type cell wall.
- GO:0009403 The chemical reactions and pathways resulting in the formation of toxin, a poisonous compound (typically a protein) that is produced by cells or organisms and that can cause disease when introduced into the body or tissues of an organism.
Sequence domains and features
Domain and signature matches imported from InterPro and related databases.
Show feature table
| Start | End | DB | Term | Name |
|---|---|---|---|---|
| 1817 | 1928 | SUPERFAMILY | SSF47336 | ACP-like |
| 1817 | 1928 | InterPro | IPR036736 | ACP-like superfamily |
| 23 | 447 | SUPERFAMILY | SSF53901 | Thiolase-like |
| 23 | 447 | InterPro | IPR016039 | Thiolase-like |
| 1910 | 2088 | FunFam | G3DSA:3.30.559.10:FF:000023 | Non-ribosomal peptide synthetase |
| 2805 | 2826 | MobiDBLite | mobidb-lite | consensus disorder prediction |
| 1915 | 2341 | CDD | cd19535 | Cyc_NRPS |
| 551 | 846 | Pfam | PF00698 | Acyl transferase domain |
| 551 | 846 | InterPro | IPR014043 | Acyl transferase |
| 1818 | 1902 | Gene3D | G3DSA:1.10.1200.10 | - |
| 1818 | 1902 | InterPro | IPR036736 | ACP-like superfamily |
| 1823 | 1889 | Pfam | PF00550 | Phosphopantetheine attachment site |
| 1823 | 1889 | InterPro | IPR009081 | Phosphopantetheine binding ACP domain |
| 2832 | 2894 | Pfam | PF00550 | Phosphopantetheine attachment site |
| 2832 | 2894 | InterPro | IPR009081 | Phosphopantetheine binding ACP domain |
| 3163 | 3163 | Coils | Coil | Coil |
| 2853 | 2868 | ProSitePatterns | PS00012 | Phosphopantetheine attachment site. |
| 2853 | 2868 | InterPro | IPR006162 | Phosphopantetheine attachment site |
| 1818 | 1893 | ProSiteProfiles | PS50075 | Carrier protein (CP) domain profile. |
| 1818 | 1893 | InterPro | IPR009081 | Phosphopantetheine binding ACP domain |
| 1435 | 1776 | CDD | cd05274 | KR_FAS_SDR_x |
| 1911 | 2109 | SUPERFAMILY | SSF52777 | CoA-dependent acyltransferases |
| 550 | 835 | SUPERFAMILY | SSF52151 | FabD/lysophospholipase-like |
| 550 | 835 | InterPro | IPR016035 | Acyl transferase/acyl hydrolase/lysophospholipase |
| 2095 | 2347 | Gene3D | G3DSA:3.30.559.30 | Nonribosomal peptide synthetase, condensation domain |
| 29 | 452 | SMART | SM00825 | Beta-ketoacyl synthase |
| 29 | 452 | InterPro | IPR020841 | Polyketide synthase, beta-ketoacyl synthase domain |
| 23 | 496 | FunFam | G3DSA:3.40.47.10:FF:000042 | Polyketide synthase Pks13 |
| 1948 | 2262 | Pfam | PF00668 | Condensation domain |
| 1948 | 2262 | InterPro | IPR001242 | Condensation domain |
| 2813 | 2902 | Gene3D | G3DSA:1.10.1200.10 | - |
| 2813 | 2902 | InterPro | IPR036736 | ACP-like superfamily |
| 1558 | 1731 | SMART | SM00822 | This enzymatic domain is part of bacterial polyketide synthases and catalyses the first step in the reductive modification of the beta-carbonyl centres in the growing polyketide chain. It uses NADPH to reduce the keto group to a hydroxy group. |
| 2098 | 2343 | SUPERFAMILY | SSF52777 | CoA-dependent acyltransferases |
| 2898 | 3152 | SUPERFAMILY | SSF53474 | alpha/beta-Hydrolases |
| 2898 | 3152 | InterPro | IPR029058 | Alpha/Beta hydrolase fold |
| 553 | 844 | SMART | SM00827 | Acyl transferase domain in polyketide synthase (PKS) enzymes. |
| 553 | 844 | InterPro | IPR014043 | Acyl transferase |
| 27 | 447 | CDD | cd00833 | PKS |
| 404 | 515 | Pfam | PF16197 | Ketoacyl-synthetase C-terminal extension |
| 404 | 515 | InterPro | IPR032821 | Polyketide synthase, C-terminal extension |
| 2918 | 3152 | SMART | SM00824 | Thioesterase |
| 2918 | 3152 | InterPro | IPR020802 | Polyketide synthase, thioesterase domain |
| 551 | 847 | Gene3D | G3DSA:3.40.366.10 | - |
| 551 | 847 | InterPro | IPR001227 | Acyl transferase domain superfamily |
| 1848 | 1863 | ProSitePatterns | PS00012 | Phosphopantetheine attachment site. |
| 1848 | 1863 | InterPro | IPR006162 | Phosphopantetheine attachment site |
| 27 | 276 | Pfam | PF00109 | Beta-ketoacyl synthase, N-terminal domain |
| 27 | 276 | InterPro | IPR014030 | Beta-ketoacyl synthase, N-terminal |
| 2830 | 2898 | SMART | SM00823 | Phosphopantetheine attachment site |
| 2830 | 2898 | InterPro | IPR020806 | Polyketide synthase, phosphopantetheine-binding domain |
| 1821 | 1893 | SMART | SM00823 | Phosphopantetheine attachment site |
| 1821 | 1893 | InterPro | IPR020806 | Polyketide synthase, phosphopantetheine-binding domain |
| 2915 | 3006 | Pfam | PF00975 | Thioesterase domain |
| 2915 | 3006 | InterPro | IPR001031 | Thioesterase |
| 1435 | 1455 | Coils | Coil | Coil |
| 1384 | 1541 | SUPERFAMILY | SSF51735 | NAD(P)-binding Rossmann-fold domains |
| 1384 | 1541 | InterPro | IPR036291 | NAD(P)-binding domain superfamily |
| 19 | 473 | Gene3D | G3DSA:3.40.47.10 | - |
| 19 | 473 | InterPro | IPR016039 | Thiolase-like |
| 675 | 736 | SUPERFAMILY | SSF55048 | Probable ACP-binding domain of malonyl-CoA ACP transacylase |
| 675 | 736 | InterPro | IPR016036 | Malonyl-CoA ACP transacylase, ACP-binding |
| 1060 | 1250 | SUPERFAMILY | SSF53335 | S-adenosyl-L-methionine-dependent methyltransferases |
| 1060 | 1250 | InterPro | IPR029063 | S-adenosyl-L-methionine-dependent methyltransferase superfamily |
| 2574 | 2750 | SUPERFAMILY | SSF53335 | S-adenosyl-L-methionine-dependent methyltransferases |
| 2574 | 2750 | InterPro | IPR029063 | S-adenosyl-L-methionine-dependent methyltransferase superfamily |
| 2905 | 3157 | Gene3D | G3DSA:3.40.50.1820 | alpha/beta hydrolase |
| 2905 | 3157 | InterPro | IPR029058 | Alpha/Beta hydrolase fold |
| 997 | 1255 | Gene3D | G3DSA:3.40.50.150 | Vaccinia Virus protein VP39 |
| 997 | 1255 | InterPro | IPR029063 | S-adenosyl-L-methionine-dependent methyltransferase superfamily |
| 2447 | 2767 | Gene3D | G3DSA:3.40.50.150 | Vaccinia Virus protein VP39 |
| 2447 | 2767 | InterPro | IPR029063 | S-adenosyl-L-methionine-dependent methyltransferase superfamily |
| 1560 | 1729 | Pfam | PF08659 | KR domain |
| 1560 | 1729 | InterPro | IPR013968 | Polyketide synthase, ketoreductase domain |
| 474 | 890 | Gene3D | G3DSA:3.30.70.3290 | - |
| 26 | 449 | ProSiteProfiles | PS52004 | Ketosynthase family 3 (KS3) domain profile. |
| 26 | 449 | InterPro | IPR020841 | Polyketide synthase, beta-ketoacyl synthase domain |
| 2824 | 2898 | ProSiteProfiles | PS50075 | Carrier protein (CP) domain profile. |
| 2824 | 2898 | InterPro | IPR009081 | Phosphopantetheine binding ACP domain |
| 2828 | 2894 | SUPERFAMILY | SSF47336 | ACP-like |
| 2828 | 2894 | InterPro | IPR036736 | ACP-like superfamily |
| 2096 | 2343 | FunFam | G3DSA:3.30.559.30:FF:000006 | Yersiniabactin polyketide/non-ribosomal peptide synthetase |
| 1093 | 1194 | Pfam | PF08242 | Methyltransferase domain |
| 1093 | 1194 | InterPro | IPR013217 | Methyltransferase type 12 |
| 2593 | 2693 | Pfam | PF08242 | Methyltransferase domain |
| 2593 | 2693 | InterPro | IPR013217 | Methyltransferase type 12 |
| 1557 | 1786 | SUPERFAMILY | SSF51735 | NAD(P)-binding Rossmann-fold domains |
| 1557 | 1786 | InterPro | IPR036291 | NAD(P)-binding domain superfamily |
| 1762 | 3021 | PANTHER | PTHR43775 | FATTY ACID SYNTHASE |
| 285 | 401 | Pfam | PF02801 | Beta-ketoacyl synthase, C-terminal domain |
| 285 | 401 | InterPro | IPR014031 | Beta-ketoacyl synthase, C-terminal |
| 189 | 205 | ProSitePatterns | PS00606 | Ketosynthase family 3 (KS3) active site signature. |
| 189 | 205 | InterPro | IPR018201 | Beta-ketoacyl synthase, active site |
| 1910 | 2090 | Gene3D | G3DSA:3.30.559.10 | - |
| 1910 | 2090 | InterPro | IPR023213 | Chloramphenicol acetyltransferase-like domain superfamily |
| 1346 | 1795 | Gene3D | G3DSA:3.40.50.720 | - |
3D structure
No structural model is available for this protein.
Structure unavailable
No pre-computed model was found in the AlphaFold database and no ColabFold prediction is available for this protein.
Ligand evidence
Ligands grouped by evidence source. PDB ligands keep the source crystal visible, and loaded crystals can be opened directly in the structure viewer.
Structural ligand evidence is available for this target.
Highest-confidence structural evidence: ligands co-crystallized with this exact protein. If the source PDB is loaded in Target, use Open crystal to inspect it in the structure viewer.
No PDB structure with a co-crystallized ligand found for this exact protein.
Structural evidence inferred from similar proteins. The source crystal indicates where the ligand was observed; the UniProt column identifies the homologous protein carrying that ligand.
| Ligand | Source crystal | UniProt (homolog) | MW · LogP · TPSA | Lipinski | PAINS | SMILES |
|---|---|---|---|---|---|---|
| 57H RCSB PDB | Q03133 | 122.1 Da LogP 0.35 TPSA 57.5 | ✓ Ro5 | ✓ Clean |
C=CCP(=O)(O)O
|
|
| 8H6 RCSB PDB | Q93NW7 | 390.5 Da LogP -0.14 TPSA 132.8 | ✓ Ro5 | ✓ Clean |
CCC(=O)[C@@H](C)C(=O)SCCNC(=O)CCNC(=O)[C@@H](C(…
|
|
| AKG RCSB PDB | Q6DNF2 | 146.1 Da LogP -0.50 TPSA 91.7 | ✓ Ro5 | ✓ Clean |
C(CC(=O)O)C(=O)C(=O)O
|
|
| DUV RCSB PDB | A0A0E3JLZ0 | 154.2 Da LogP 0.69 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
C#CCCCC(C=O)C(=O)O
|
|
| DUW RCSB PDB | A0A0E3JLZ0 | 178.2 Da LogP 1.13 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
c1ccc(cc1)C[C@H](C=O)C(=O)O
|
|
| E5U RCSB PDB | Q8KUH4 | 134.1 Da LogP -0.83 TPSA 83.8 | ✓ Ro5 | ✓ Clean |
COC(C(=O)O)C(=O)O
|
|
| LMR RCSB PDB | Q93NW7 | 134.1 Da LogP -1.09 TPSA 94.8 | ✓ Ro5 | ✓ Clean |
C([C@@H](C(=O)O)O)C(=O)O
|
|
| MLT RCSB PDB | Q93NW7 | 134.1 Da LogP -1.09 TPSA 94.8 | ✓ Ro5 | ✓ Clean |
C([C@H](C(=O)O)O)C(=O)O
|
|
| PNS RCSB PDB | Q6DNF2 | 358.4 Da LogP -0.96 TPSA 145.2 | 1 viol. | ✓ Clean |
CC(C)(COP(=O)(O)O)[C@H](C(=O)NCCC(=O)NCCS)O
|
Experimental bioactivity from ChEMBL measured directly on this protein. Score = pchembl (−log Ki/IC₅₀; higher = more potent).
No ChEMBL bioactivity data found for this exact protein.
Bioactivity inferred from similar proteins in ChEMBL. Score = pchembl (−log Ki/IC₅₀; higher = more potent).
No ChEMBL hits found through similar proteins.
Proposed virtual-screening candidates from ZINC. Score = Tanimoto similarity to a known binder (0–1; higher = more similar).
| Ligand | Tanimoto | MW · LogP · TPSA | Lipinski | PAINS | SMILES |
|---|---|---|---|---|---|
| ZINC71773889 ZINC | 0.667 | 206.1 Da LogP -1.77 TPSA 132.1 | ✓ Ro5 | ✓ Clean |
O=C(C[C@H](O)C(=O)O)C[C@H](O)C(=O)O
|
| ZINC71773890 ZINC | 0.667 | 206.1 Da LogP -1.77 TPSA 132.1 | ✓ Ro5 | ✓ Clean |
O=C(C[C@H](O)C(=O)O)C[C@@H](O)C(=O)O
|
| ZINC71773891 ZINC | 0.667 | 206.1 Da LogP -1.77 TPSA 132.1 | ✓ Ro5 | ✓ Clean |
O=C(C[C@@H](O)C(=O)O)C[C@@H](O)C(=O)O
|
| ZINC31938448 ZINC | 0.656 | 266.3 Da LogP 3.25 TPSA 34.1 | ✓ Ro5 | ✓ Clean |
O=C[C@@H](Cc1ccccc1)C(=O)CCc1ccccc1
|
| ZINC31938449 ZINC | 0.656 | 266.3 Da LogP 3.25 TPSA 34.1 | ✓ Ro5 | ✓ Clean |
O=C[C@H](Cc1ccccc1)C(=O)CCc1ccccc1
|
| ZINC3869683 ZINC | 0.643 | 278.4 Da LogP -1.08 TPSA 98.7 | ✓ Ro5 | ✓ Clean |
CC(C)(CO)[C@H](O)C(=O)NCCC(=O)NCCS
|
| ZINC3869684 ZINC | 0.643 | 278.4 Da LogP -1.08 TPSA 98.7 | ✓ Ro5 | ✓ Clean |
CC(C)(CO)[C@@H](O)C(=O)NCCC(=O)NCCS
|
| ZINC73739659 ZINC | 0.636 | 206.2 Da LogP 1.61 TPSA 43.4 | ✓ Ro5 | ✓ Clean |
CCOC(=O)[C@H](C=O)Cc1ccccc1
|
| ZINC73739661 ZINC | 0.636 | 206.2 Da LogP 1.61 TPSA 43.4 | ✓ Ro5 | ✓ Clean |
CCOC(=O)[C@@H](C=O)Cc1ccccc1
|
| ZINC27644247 ZINC | 0.618 | 230.3 Da LogP 0.09 TPSA 111.2 | ✓ Ro5 | ✓ Clean |
CCCCNC(=N)NCCC[C@H](N)C(=O)O
|
| ZINC196899382 ZINC | 0.588 | 228.2 Da LogP -0.14 TPSA 92.4 | ✓ Ro5 | ✓ Clean |
N[C@@H](CCCNC(=O)C(F)(F)F)C(=O)O
|
| ZINC4155291 ZINC | 0.583 | 216.2 Da LogP -1.37 TPSA 130.8 | ✓ Ro5 | ✓ Clean |
CC(=O)/N=C(\N)NCCC[C@H](N)C(=O)O
|
| ZINC4155299 ZINC | 0.583 | 216.2 Da LogP -1.37 TPSA 130.8 | ✓ Ro5 | ✓ Clean |
CC(=O)/N=C(\N)NCCC[C@@H](N)C(=O)O
|
| ZINC1529718 ZINC | 0.571 | 202.3 Da LogP -0.74 TPSA 102.4 | ✓ Ro5 | ✓ Clean |
CN(C)C(=N)NCCC[C@H](N)C(=O)O
|
| ZINC1546170 ZINC | 0.571 | 216.3 Da LogP -0.30 TPSA 111.2 | ✓ Ro5 | ✓ Clean |
CCCNC(=N)NCCC[C@H](N)C(=O)O
|
| ZINC1693352 ZINC | 0.571 | 240.3 Da LogP 3.17 TPSA 37.3 | ✓ Ro5 | ✓ Clean |
O=C(O)C(Cc1ccccc1)Cc1ccccc1
|
| ZINC2560273 ZINC | 0.571 | 202.3 Da LogP -0.69 TPSA 111.2 | ✓ Ro5 | ✓ Clean |
CCNC(=N)NCCC[C@H](N)C(=O)O
|
| ZINC35874629 ZINC | 0.571 | 224.3 Da LogP 3.29 TPSA 17.1 | ✓ Ro5 | ✓ Clean |
O=CC(Cc1ccccc1)Cc1ccccc1
|
| ZINC4543782 ZINC | 0.571 | 202.3 Da LogP -0.74 TPSA 102.4 | ✓ Ro5 | ✓ Clean |
CN(C)C(=N)NCCC[C@@H](N)C(=O)O
|
| ZINC7997269 ZINC | 0.571 | 205.3 Da LogP 0.07 TPSA 99.2 | ✓ Ro5 | ✓ Clean |
CSC(=N)NCCC[C@@H](N)C(=O)O
|
| ZINC144076260 ZINC | 0.559 | 232.2 Da LogP -0.84 TPSA 129.7 | ✓ Ro5 | ✓ Clean |
N[C@@H](CCCCNC(=O)CC(=O)O)C(=O)O
|
| ZINC218922593 ZINC | 0.559 | 204.2 Da LogP -1.32 TPSA 112.6 | ✓ Ro5 | ✓ Clean |
N[C@@H](CCCCNC(=O)CO)C(=O)O
|
| ZINC2516116 ZINC | 0.559 | 275.3 Da LogP -1.12 TPSA 155.7 | ✓ Ro5 | ✓ Clean |
N[C@@H](CCCCNC(=O)CC[C@H](N)C(=O)O)C(=O)O
|
| ZINC4545887 ZINC | 0.559 | 275.3 Da LogP -1.12 TPSA 155.7 | ✓ Ro5 | ✓ Clean |
N[C@@H](CCCCNC(=O)CC[C@@H](N)C(=O)O)C(=O)O
|
| ZINC4545888 ZINC | 0.559 | 275.3 Da LogP -1.12 TPSA 155.7 | ✓ Ro5 | ✓ Clean |
N[C@@H](CCC(=O)NCCCC[C@@H](N)C(=O)O)C(=O)O
|
| ZINC4545889 ZINC | 0.559 | 275.3 Da LogP -1.12 TPSA 155.7 | ✓ Ro5 | ✓ Clean |
N[C@H](CCCCNC(=O)CC[C@@H](N)C(=O)O)C(=O)O
|
| ZINC50027904 ZINC | 0.559 | 261.3 Da LogP -1.51 TPSA 155.7 | ✓ Ro5 | ✓ Clean |
N[C@@H](CCCCNC(=O)C[C@H](N)C(=O)O)C(=O)O
|
| ZINC12503853 ZINC | 0.556 | 201.3 Da LogP 0.55 TPSA 99.2 | ✓ Ro5 | ✓ Clean |
CCCC(=N)NCCC[C@H](N)C(=O)O
|
| ZINC1640080 ZINC | 0.556 | 232.3 Da LogP 0.70 TPSA 101.6 | ✓ Ro5 | ✓ Clean |
CC(C)(C)OC(=O)NCCC[C@H](N)C(=O)O
|
| ZINC217503161 ZINC | 0.556 | 230.3 Da LogP 0.88 TPSA 92.4 | ✓ Ro5 | ✓ Clean |
CCCCC(=O)NCCCC[C@H](N)C(=O)O
|
| ZINC2560765 ZINC | 0.556 | 232.3 Da LogP 0.70 TPSA 101.6 | ✓ Ro5 | ✓ Clean |
CC(C)(C)OC(=O)NCCC[C@@H](N)C(=O)O
|
| ZINC3055005 ZINC | 0.556 | 204.2 Da LogP -0.63 TPSA 126.6 | ✓ Ro5 | ✓ Clean |
N[C@@H](CCCC[C@H](N)C(=O)O)C(=O)O
|
| ZINC3055007 ZINC | 0.556 | 204.2 Da LogP -0.63 TPSA 126.6 | ✓ Ro5 | ✓ Clean |
N[C@@H](CCCC[C@@H](N)C(=O)O)C(=O)O
|
| ZINC3055010 ZINC | 0.556 | 204.2 Da LogP -0.63 TPSA 126.6 | ✓ Ro5 | ✓ Clean |
N[C@H](CCCC[C@@H](N)C(=O)O)C(=O)O
|
| ZINC675038108 ZINC | 0.556 | 231.3 Da LogP -1.49 TPSA 123.3 | 1 viol. | ✓ Clean |
CNC(NC)C(=N)NCCC[C@H](N)C(=O)O
|
| ZINC100017163 ZINC | 0.553 | 213.3 Da LogP 0.71 TPSA 99.2 | ✓ Ro5 | ✓ Clean |
C/C=C/CC(=N)NCCC[C@H](N)C(=O)O
|
| ZINC19796052 ZINC | 0.553 | 219.2 Da LogP -1.73 TPSA 156.9 | ✓ Ro5 | ✓ Clean |
N/C(=N\[N+](=O)[O-])NCCC[C@H](N)C(=O)O
|
| ZINC21982226 ZINC | 0.553 | 219.2 Da LogP -1.73 TPSA 156.9 | ✓ Ro5 | ✓ Clean |
N/C(=N\[N+](=O)[O-])NCCC[C@@H](N)C(=O)O
|
| ZINC5113209 ZINC | 0.548 | 275.3 Da LogP -0.26 TPSA 138.7 | ✓ Ro5 | ✓ Clean |
N[C@@H](CCCCNCCCC[C@H](N)C(=O)O)C(=O)O
|
| ZINC13545298 ZINC | 0.543 | 202.3 Da LogP 0.09 TPSA 92.4 | ✓ Ro5 | ✓ Clean |
CCC(=O)NCCCC[C@H](N)C(=O)O
|
| ZINC216616240 ZINC | 0.543 | 430.5 Da LogP 0.72 TPSA 184.8 | 1 viol. | ✓ Clean |
N[C@@H](CCCCNC(=O)CCCCCCC(=O)NCCCC[C@H](N)C(=O)…
|
| ZINC6360447 ZINC | 0.543 | 222.3 Da LogP 0.37 TPSA 75.3 | ✓ Ro5 | ✓ Clean |
N[C@H](CCCCNC(=S)S)C(=O)O
|
| ZINC1530092 ZINC | 0.541 | 254.2 Da LogP -1.61 TPSA 168.8 | 1 viol. | ✓ Clean |
N=C(NCCC[C@H](N)C(=O)O)NP(=O)(O)O
|
| ZINC230402790 ZINC | 0.541 | 214.3 Da LogP 0.26 TPSA 92.4 | ✓ Ro5 | ✓ Clean |
C/C=C/C(=O)NCCCC[C@H](N)C(=O)O
|
| ZINC237993466 ZINC | 0.541 | 214.3 Da LogP 0.26 TPSA 92.4 | ✓ Ro5 | ✓ Clean |
C/C=C/C(=O)NCCCC[C@@H](N)C(=O)O
|
| ZINC2509855 ZINC | 0.541 | 216.2 Da LogP 0.09 TPSA 101.6 | ✓ Ro5 | ✓ Clean |
C=CCOC(=O)NCCC[C@H](N)C(=O)O
|
| ZINC5965908 ZINC | 0.541 | 202.3 Da LogP -1.03 TPSA 99.7 | ✓ Ro5 | ✓ Clean |
C/N=C(\NC)NCCC[C@H](N)C(=O)O
|
| ZINC98044182 ZINC | 0.541 | 216.2 Da LogP 0.09 TPSA 101.6 | ✓ Ro5 | ✓ Clean |
C=CCOC(=O)NCCC[C@@H](N)C(=O)O
|
| ZINC1555366 ZINC | 0.536 | 232.3 Da LogP 0.15 TPSA 126.6 | ✓ Ro5 | ✓ Clean |
N[C@@H](CCCCCC[C@H](N)C(=O)O)C(=O)O
|
| ZINC1555369 ZINC | 0.536 | 232.3 Da LogP 0.15 TPSA 126.6 | ✓ Ro5 | ✓ Clean |
N[C@H](CCCCCC[C@@H](N)C(=O)O)C(=O)O
|
PDB and ChEMBL records on this protein are shown in full. ChEMBL records from similar proteins are capped at the top 100 per protein (by pchembl) and ZINC at the top 50 (Tanimoto ≥ 0.5). ADME columns are descriptor-based screening flags, not experimental toxicity results.
Cross-references
External database identifiers for this protein, its structures, ligands, and metabolic reactions.