Overview
Basic information about this protein and its source genome.
- Accession
- KP13_03824
- Gene
- AHE43308.1
- Status
- annotated
- Amino acids
- 292
- Structure source
- Experimental + ColabFold
Target profile
Computed evidence for target prioritization.
- Human off-target
- hit
- Human identity (%)
- 29.167
- Human E-value
- 4.76e-22
- Gut microbiome off-target
- hit
- Essential (DEG)
- Y
- DEG identity (%)
- 92.123
- DEG E-value
- 0.0
- Localization
- Cytoplasmic
- ColabFold pLDDT
- 98.56
Selected Druggability evidence
PDB experimental structureSelected Druggability is the FPocket score chosen for ranking using the curated structure priority. The 3D viewer may show a different loaded structure, so its visible pockets can differ.
Sequence
Primary amino-acid sequence viewer.
Functional Annotations
Enzyme classification and Gene Ontology terms linked to this protein.
Enzyme Commission (EC)
1Gene Ontology (GO)
5- GO:0009089 OBSOLETE. The chemical reactions and pathways resulting in the formation of lysine, via the intermediate diaminopimelate.
- GO:0016829 Catalysis of the cleavage of C-C, C-O, C-N and other bonds by other means than by hydrolysis or oxidation, or conversely adding a group to a double bond. They differ from other enzymes in that two substrates are involved in one reaction direction, but only one in the other direction. When acting on the single substrate, a molecule is eliminated and this generates either a new double bond or a new ring.
- GO:0008840 Catalysis of the reaction: L-aspartate 4-semialdehyde + pyruvate = (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H2O + H+.
- GO:0005829 The part of the cytoplasm that does not contain organelles but which does contain other particulate matter, such as protein complexes.
- GO:0019877 OBSOLETE. The chemical reactions and pathways resulting in the formation of diaminopimelate, both as an intermediate in lysine biosynthesis and as a component (as meso-diaminopimelate) of the peptidoglycan of Gram-negative bacterial cell walls.
Sequence Features
Domain/signature hits from InterPro and related databases.
Show feature table
| Start | End | DB | Term | Name |
|---|---|---|---|---|
| 4 | 288 | NCBIfam | TIGR00674 | 4-hydroxy-tetrahydrodipicolinate synthase |
| 4 | 288 | InterPro | IPR005263 | 4-hydroxy-tetrahydrodipicolinate synthase, DapA |
| 2 | 291 | PANTHER | PTHR12128 | DIHYDRODIPICOLINATE SYNTHASE |
| 2 | 291 | InterPro | IPR002220 | DapA-like |
| 35 | 56 | PRINTS | PR00146 | Dihydrodipicolinate synthase signature |
| 35 | 56 | InterPro | IPR002220 | DapA-like |
| 128 | 145 | PRINTS | PR00146 | Dihydrodipicolinate synthase signature |
| 128 | 145 | InterPro | IPR002220 | DapA-like |
| 71 | 89 | PRINTS | PR00146 | Dihydrodipicolinate synthase signature |
| 71 | 89 | InterPro | IPR002220 | DapA-like |
| 103 | 119 | PRINTS | PR00146 | Dihydrodipicolinate synthase signature |
| 103 | 119 | InterPro | IPR002220 | DapA-like |
| 1 | 292 | PIRSF | PIRSF001365 | DHDPS |
| 1 | 292 | InterPro | IPR002220 | DapA-like |
| 2 | 286 | CDD | cd00950 | DHDPS |
| 2 | 286 | InterPro | IPR005263 | 4-hydroxy-tetrahydrodipicolinate synthase, DapA |
| 2 | 288 | Pfam | PF00701 | Dihydrodipicolinate synthetase family |
| 2 | 288 | InterPro | IPR002220 | DapA-like |
| 1 | 288 | Hamap | MF_00418 | 4-hydroxy-tetrahydrodipicolinate synthase [dapA]. |
| 1 | 288 | InterPro | IPR005263 | 4-hydroxy-tetrahydrodipicolinate synthase, DapA |
| 1 | 290 | SMART | SM01130 | DHDPS_2 |
| 1 | 290 | InterPro | IPR002220 | DapA-like |
| 133 | 163 | ProSitePatterns | PS00666 | Dihydrodipicolinate synthase signature 2. |
| 133 | 163 | InterPro | IPR020625 | Schiff base-forming aldolase, active site |
| 1 | 292 | FunFam | G3DSA:3.20.20.70:FF:000046 | 4-hydroxy-tetrahydrodipicolinate synthase |
| 1 | 292 | SUPERFAMILY | SSF51569 | Aldolase |
| 1 | 292 | Gene3D | G3DSA:3.20.20.70 | Aldolase class I |
| 1 | 292 | InterPro | IPR013785 | Aldolase-type TIM barrel |
| 38 | 55 | ProSitePatterns | PS00665 | Dihydrodipicolinate synthase signature 1. |
| 38 | 55 | InterPro | IPR020624 | Schiff base-forming aldolase, conserved site |
3D Structure
Selected loaded structure. Experimental PDB entries may cover only a portion of the sequence; predicted models typically cover the full protein.
Loading 3D structure...
Structural evidence
1 + 1Experimental PDB entries and predicted models. Click Switch to display a different structure in the viewer.
Pocket details FPocket · P2Rank — toggle visibility and zoom from here, or open full viewer
Pockets (FPOCKET)
Showing top-ranked FPocket candidates by druggability. Druggability is color-coded: high (0.7 or higher), medium (0.4 to 0.69), low (below 0.4).
| FPOCKET | Sticks | Spheres | Surfaces | Druggability | Labels | Zoom | Positions |
|---|---|---|---|---|---|---|---|
| 1 | 0.319 | ||||||
| 5 | 0.249 | ||||||
| 20 | 0.247 |
Pockets (P2RANK)
Showing top-ranked P2Rank candidates by probability. Probability is color-coded per P2Rank calibration: high (≥ 0.5), medium (0.2 – 0.49), low (< 0.2).
| P2RANK | Sticks | Spheres | Surfaces | Score | Probability | Labels | Zoom | Positions |
|---|---|---|---|---|---|---|---|---|
| 1 | 37.02 | 0.957 | ||||||
| 2 | 10.24 | 0.55 | ||||||
| 3 | 9.41 | 0.506 | ||||||
| 4 | 1.29 | 0.014 | ||||||
| 5 | 1.13 | 0.008 |
Pockets (FPOCKET)
Showing top-ranked FPocket candidates by druggability. Druggability is color-coded: high (0.7 or higher), medium (0.4 to 0.69), low (below 0.4).
| FPOCKET | Sticks | Spheres | Surfaces | Druggability | Labels | Zoom | Positions |
|---|---|---|---|---|---|---|---|
| 1 | 0.749 |
Pockets (P2RANK)
Showing top-ranked P2Rank candidates by probability. Probability is color-coded per P2Rank calibration: high (≥ 0.5), medium (0.2 – 0.49), low (< 0.2).
| P2RANK | Sticks | Spheres | Surfaces | Score | Probability | Labels | Zoom | Positions |
|---|---|---|---|---|---|---|---|---|
| 1 | 15.76 | 0.761 | ||||||
| 2 | 1.39 | 0.017 |
Ligand evidence
Ligands grouped by evidence source. PDB ligands keep the source crystal visible, and loaded crystals can be opened directly in the structure viewer.
Highest-confidence structural evidence: ligands co-crystallized with this exact protein. If the source PDB is loaded in TPW, use Open crystal to inspect it in the structure viewer.
No PDB structure with a co-crystallized ligand found for this exact protein.
Structural evidence inferred from similar proteins. The source crystal indicates where the ligand was observed; the UniProt column identifies the homologous protein carrying that ligand.
| Ligand | Source crystal | UniProt (homolog) | MW · LogP · TPSA | Lipinski | PAINS | SMILES |
|---|---|---|---|---|---|---|
| 2KT | D0CFC3 | 102.1 Da LogP 0.05 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CCC(=O)C(=O)O
|
|
| 3OH | Q9I4W3 | 90.1 Da LogP -0.55 TPSA 57.5 | ✓ Ro5 | ✓ Clean |
C(CO)C(=O)O
|
|
| FLC | A9DKW4 | 189.1 Da LogP -5.25 TPSA 140.6 | ✓ Ro5 | ✓ Clean |
C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O
|
|
| LYZ | D0CFC3 | 162.2 Da LogP -1.50 TPSA 109.6 | ✓ Ro5 | ✓ Clean |
C(C[C@@H](C(=O)O)N)[C@H](CN)O
|
|
| OXL | D0CFC3 | 88.0 Da LogP -3.51 TPSA 80.3 | ✓ Ro5 | ✓ Clean |
C(=O)(C(=O)[O-])[O-]
|
|
| PYR | D0CFC3 | 88.1 Da LogP -0.34 TPSA 54.4 | ✓ Ro5 | ✓ Clean |
CC(=O)C(=O)O
|
|
| TLA | P0A6L2 | 150.1 Da LogP -2.12 TPSA 115.1 | ✓ Ro5 | ✓ Clean |
[C@@H]([C@H](C(=O)O)O)(C(=O)O)O
|
Experimental bioactivity from ChEMBL measured directly on this protein. Score = pchembl (−log Ki/IC₅₀; higher = more potent).
No ChEMBL bioactivity data found for this exact protein.
Bioactivity inferred from similar proteins in ChEMBL. Score = pchembl (−log Ki/IC₅₀; higher = more potent).
| Ligand | UniProt (homolog) | pchembl | MW · LogP · TPSA | Lipinski | PAINS | SMILES |
|---|---|---|---|---|---|---|
| CHEMBL456197 | P0A6L2 | — | 226.2 Da LogP 0.79 TPSA 69.7 | ✓ Ro5 | ✓ Clean |
CCOC(=O)/C=C/C(=O)/C=C/C(=O)OCC
|
Proposed virtual-screening candidates from ZINC. Score = Tanimoto similarity to a known binder (0–1; higher = more similar).
| Ligand | Tanimoto | MW · LogP · TPSA | Lipinski | PAINS | SMILES |
|---|---|---|---|---|---|
| ZINC12359024 | 0.692 | 210.1 Da LogP -3.40 TPSA 155.5 | 1 viol. | ✓ Clean |
O=C(O)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C(=O)O
|
| ZINC13533920 | 0.692 | 210.1 Da LogP -3.40 TPSA 155.5 | 1 viol. | ✓ Clean |
O=C(O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)C(=O)O
|
| ZINC1532740 | 0.692 | 210.1 Da LogP -3.40 TPSA 155.5 | 1 viol. | ✓ Clean |
O=C(O)[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)C(=O)O
|
| ZINC1549593 | 0.692 | 210.1 Da LogP -3.40 TPSA 155.5 | 1 viol. | ✓ Clean |
O=C(O)[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)C(=O)O
|
| ZINC2013424 | 0.692 | 210.1 Da LogP -3.40 TPSA 155.5 | 1 viol. | ✓ Clean |
O=C(O)[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)O
|
| ZINC3581021 | 0.692 | 210.1 Da LogP -3.40 TPSA 155.5 | 1 viol. | ✓ Clean |
O=C(O)[C@H](O)[C@@H](O)[C@@H](O)[C@@H](O)C(=O)O
|
| ZINC3860635 | 0.692 | 210.1 Da LogP -3.40 TPSA 155.5 | 1 viol. | ✓ Clean |
O=C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)C(=O)O
|
| ZINC5783661 | 0.692 | 210.1 Da LogP -3.40 TPSA 155.5 | 1 viol. | ✓ Clean |
O=C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)O
|
| ZINC6072527 | 0.692 | 210.1 Da LogP -3.40 TPSA 155.5 | 1 viol. | ✓ Clean |
O=C(O)[C@@H](O)[C@@H](O)[C@@H](O)[C@@H](O)C(=O)O
|
| ZINC32298862 | 0.652 | 226.0 Da LogP 1.50 TPSA 26.3 | ✓ Ro5 | ✓ Clean |
CCOC(=O)/C=C/I
|
| ZINC3593496 | 0.652 | 206.2 Da LogP -1.16 TPSA 121.1 | ✓ Ro5 | ✓ Clean |
COC(=O)C[C@@](O)(CC(=O)O)C(=O)O
|
| ZINC3593497 | 0.652 | 206.2 Da LogP -1.16 TPSA 121.1 | ✓ Ro5 | ✓ Clean |
COC(=O)C[C@](O)(CC(=O)O)C(=O)O
|
| ZINC4975987 | 0.652 | 226.0 Da LogP 1.50 TPSA 26.3 | ✓ Ro5 | ✓ Clean |
CCOC(=O)/C=C\I
|
| ZINC4195949 | 0.630 | 338.4 Da LogP -0.10 TPSA 93.2 | ✓ Ro5 | ✓ Clean |
CCOC(=O)/C=C/C(=O)N1CCN(C(=O)/C=C/C(=O)OCC)CC1
|
| ZINC5113885 | 0.630 | 307.3 Da LogP -2.32 TPSA 179.1 | 1 viol. | ✓ Clean |
N[C@@H](CC[C@H](O)CNC[C@H](O)CC[C@H](N)C(=O)O)C…
|
| ZINC5113891 | 0.630 | 307.3 Da LogP -2.32 TPSA 179.1 | 1 viol. | ✓ Clean |
N[C@@H](CC[C@@H](O)CNC[C@H](O)CC[C@H](N)C(=O)O)…
|
| ZINC14686440 | 0.625 | 436.4 Da LogP -2.64 TPSA 247.9 | 1 viol. | ✓ Clean |
O=C(O)C[C@](O)(CC(=O)NCCCCNC(=O)C[C@@](O)(CC(=O…
|
| ZINC14686442 | 0.625 | 436.4 Da LogP -2.64 TPSA 247.9 | 1 viol. | ✓ Clean |
O=C(O)C[C@@](O)(CC(=O)NCCCCNC(=O)C[C@](O)(CC(=O…
|
| ZINC14686444 | 0.625 | 436.4 Da LogP -2.64 TPSA 247.9 | 1 viol. | ✓ Clean |
O=C(O)C[C@@](O)(CC(=O)NCCCCNC(=O)C[C@@](O)(CC(=…
|
| ZINC115979184 | 0.615 | 200.2 Da LogP 1.45 TPSA 52.6 | ✓ Ro5 | ✓ Clean |
CCOC(=O)/C=C/C(=O)OC(C)(C)C
|
| ZINC136715593 | 0.593 | 304.4 Da LogP 3.67 TPSA 52.6 | ✓ Ro5 | ✓ Clean |
CCOC(=O)/C=C/C(C)=C/C=C/C=C(C)/C=C/C(=O)OCC
|
| ZINC2159520 | 0.593 | 274.4 Da LogP 3.53 TPSA 43.4 | ✓ Ro5 | ✓ Clean |
CCOC(=O)/C=C/C(=O)c1c(C)c(C)c(C)c(C)c1C
|
| ZINC33380881 | 0.593 | 274.4 Da LogP 3.53 TPSA 43.4 | ✓ Ro5 | ✓ Clean |
CCOC(=O)/C=C\C(=O)c1c(C)c(C)c(C)c(C)c1C
|
| ZINC1560405156 | 0.588 | 208.1 Da LogP -1.79 TPSA 155.5 | 1 viol. | ✓ Clean |
O=C(O)/C(O)=C(\O)[C@H](O)[C@H](O)C(=O)O
|
| ZINC1560405157 | 0.588 | 208.1 Da LogP -1.79 TPSA 155.5 | 1 viol. | ✓ Clean |
O=C(O)/C(O)=C(/O)[C@H](O)[C@H](O)C(=O)O
|
| ZINC13398039 | 0.577 | 234.2 Da LogP -0.38 TPSA 121.1 | ✓ Ro5 | ✓ Clean |
CC(C)OC(=O)C[C@](O)(CC(=O)O)C(=O)O
|
| ZINC1670412 | 0.577 | 254.3 Da LogP 2.79 TPSA 52.6 | ✓ Ro5 | ✓ Clean |
CCOC(=O)/C=C/CCCC/C=C/C(=O)OCC
|
| ZINC17300545 | 0.577 | 254.3 Da LogP 2.79 TPSA 52.6 | ✓ Ro5 | ✓ Clean |
CCOC(=O)/C=C\CCCC/C=C/C(=O)OCC
|
| ZINC2528012 | 0.577 | 234.2 Da LogP -0.38 TPSA 121.1 | ✓ Ro5 | ✓ Clean |
CC(C)OC(=O)C[C@@](O)(CC(=O)O)C(=O)O
|
| ZINC8615431 | 0.577 | 254.3 Da LogP 2.79 TPSA 52.6 | ✓ Ro5 | ✓ Clean |
CCOC(=O)/C=C\CCCC/C=C\C(=O)OCC
|
| ZINC12506611 | 0.571 | 201.1 Da LogP 0.10 TPSA 83.5 | ✓ Ro5 | ✓ Clean |
N[C@@H](CC[C@@H](O)C(F)(F)F)C(=O)O
|
| ZINC12506613 | 0.571 | 201.1 Da LogP 0.10 TPSA 83.5 | ✓ Ro5 | ✓ Clean |
N[C@H](CC[C@@H](O)C(F)(F)F)C(=O)O
|
| ZINC12506615 | 0.571 | 201.1 Da LogP 0.10 TPSA 83.5 | ✓ Ro5 | ✓ Clean |
N[C@@H](CC[C@H](O)C(F)(F)F)C(=O)O
|
| ZINC12506617 | 0.571 | 201.1 Da LogP 0.10 TPSA 83.5 | ✓ Ro5 | ✓ Clean |
N[C@H](CC[C@H](O)C(F)(F)F)C(=O)O
|
| ZINC146315135 | 0.560 | 204.2 Da LogP 0.86 TPSA 94.8 | ✓ Ro5 | ✓ Clean |
CCCCC[C@@](O)(CC(=O)O)C(=O)O
|
| ZINC146315336 | 0.560 | 204.2 Da LogP 0.86 TPSA 94.8 | ✓ Ro5 | ✓ Clean |
CCCCC[C@](O)(CC(=O)O)C(=O)O
|
| ZINC14510370 | 0.556 | 244.4 Da LogP 3.74 TPSA 57.5 | ✓ Ro5 | ✓ Clean |
O=C(O)CCCCCCCCCCCCCO
|
| ZINC1531061 | 0.556 | 216.3 Da LogP 2.96 TPSA 57.5 | ✓ Ro5 | ✓ Clean |
O=C(O)CCCCCCCCCCCO
|
| ZINC1610426 | 0.556 | 230.3 Da LogP 3.35 TPSA 57.5 | ✓ Ro5 | ✓ Clean |
O=C(O)CCCCCCCCCCCCO
|
| ZINC1684804 | 0.556 | 217.5 Da LogP 2.48 TPSA 26.3 | ✓ Ro5 | ✓ Clean |
CCOC(=O)/C=C/C(Cl)(Cl)Cl
|
| ZINC2168567 | 0.556 | 202.3 Da LogP 2.57 TPSA 57.5 | ✓ Ro5 | ✓ Clean |
O=C(O)CCCCCCCCCCO
|
| ZINC3861297 | 0.556 | 272.4 Da LogP 4.52 TPSA 57.5 | ✓ Ro5 | ✓ Clean |
O=C(O)CCCCCCCCCCCCCCCO
|
| ZINC4284502 | 0.556 | 258.4 Da LogP 4.13 TPSA 57.5 | ✓ Ro5 | ✓ Clean |
O=C(O)CCCCCCCCCCCCCCO
|
| ZINC5287109 | 0.556 | 286.5 Da LogP 4.91 TPSA 57.5 | ✓ Ro5 | ✓ Clean |
O=C(O)CCCCCCCCCCCCCCCCO
|
| ZINC2028757 | 0.552 | 215.2 Da LogP 0.50 TPSA 85.2 | ✓ Ro5 | ✓ Clean |
CCOC(=O)/C=C/C(=N/O)C(=O)OCC
|
| ZINC26896999 | 0.552 | 234.2 Da LogP 1.82 TPSA 52.6 | ✓ Ro5 | ✓ Clean |
CCOC(=O)/C=C/C(F)=C(\F)C(=O)OCC
|
| ZINC100135524 | 0.542 | 200.2 Da LogP 1.45 TPSA 52.6 | ✓ Ro5 | ✓ Clean |
CCCOC(=O)/C=C\C(=O)OCCC
|
| ZINC4404469 | 0.542 | 200.2 Da LogP 1.45 TPSA 52.6 | ✓ Ro5 | ✓ Clean |
CCCOC(=O)/C=C/C(=O)OCCC
|
| ZINC2040347175 | 0.536 | 274.3 Da LogP 2.84 TPSA 52.6 | ✓ Ro5 | ✓ Clean |
CCOC(=O)C=Cc1ccc(C=CC(=O)OCC)cc1
|
| ZINC96301090 | 0.536 | 200.2 Da LogP 0.07 TPSA 89.3 | ✓ Ro5 | ✓ Clean |
N[C@H](CC[C@@H](N)C(F)(F)F)C(=O)O
|
PDB and ChEMBL records on this protein are shown in full. ChEMBL records from similar proteins are capped at the top 100 per protein (by pchembl) and ZINC at the top 50 (Tanimoto ≥ 0.5). ADME columns are descriptor-based screening flags, not experimental toxicity results.